(S)-N-(2-(2-(2-(2-(4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)acetamido)ethoxy)ethoxy)ethyl)-3-(N-(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl)benzamide

ID: ALA5274337

Max Phase: Preclinical

Molecular Formula: C42H42ClN9O6S2

Molecular Weight: 868.44

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCOCCOCCNC(=O)c1cccc(S(=O)(=O)Nc3ccc(C)c4c(C#N)c[nH]c34)c1)c1nnc(C)n1-2

Standard InChI:  InChI=1S/C42H42ClN9O6S2/c1-24-8-13-33(39-36(24)30(22-44)23-47-39)51-60(55,56)32-7-5-6-29(20-32)41(54)46-15-17-58-19-18-57-16-14-45-35(53)21-34-40-50-49-27(4)52(40)42-37(25(2)26(3)59-42)38(48-34)28-9-11-31(43)12-10-28/h5-13,20,23,34,47,51H,14-19,21H2,1-4H3,(H,45,53)(H,46,54)/t34-/m0/s1

Standard InChI Key:  AXAFSTIEKGDKLM-UMSFTDKQSA-N

Molfile:  

 
     RDKit          2D

 60 66  0  0  0  0  0  0  0  0999 V2000
   -9.4804    1.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6554    1.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1604    2.3528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3904    2.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7304    2.6278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9329    2.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5204    3.1503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0704    3.7553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8129    3.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5279    3.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5754    1.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7504    1.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3379    0.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5129    0.9778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1004    0.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2754    0.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8629   -0.4522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0379   -0.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6254   -1.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1995   -1.1671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6120   -1.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4373   -1.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8497   -2.5975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6749   -2.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0873   -3.3123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0875   -1.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6751   -1.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0871   -0.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9126   -0.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3246   -1.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9163   -1.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1498   -1.1662    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5625   -1.8808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3877   -1.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8006   -1.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6233   -1.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0361   -1.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6268   -2.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8021   -2.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5518   -3.3844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2218   -3.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8862   -3.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6833   -3.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4804   -3.8038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8613   -1.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8658   -0.7527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1498   -0.3409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7504    0.2628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9329    0.9503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7304    0.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9229   -0.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7204   -0.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9129   -1.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3079   -1.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4729   -2.4597    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.5104   -1.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3179   -0.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3904    1.2803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1604    1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4354    0.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 11  6  1  0
 11 12  1  6
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 34 39  1  0
 39 40  1  0
 41 40  1  0
 42 41  2  0
 38 42  1  0
 43 42  1  0
 43 44  3  0
 37 45  1  0
 32 46  2  0
 32 47  2  0
 13 48  2  0
 49 11  1  0
 50 49  2  0
 50 51  1  0
 51 52  1  0
 53 52  2  0
 54 53  1  0
 54 55  1  0
 56 54  2  0
 57 56  1  0
 51 57  2  0
 58 50  1  0
  4 58  2  0
 59 58  1  0
 59  2  2  0
 60 59  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5274337

    ---

Associated Targets(Human)

BRD4 Tchem von Hippel-Lindau disease tumor suppressor/Bromodomain-containing protein 4 (105 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SUD4 (402 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 868.44Molecular Weight (Monoisotopic): 867.2388AlogP: 6.23#Rotatable Bonds: 16
Polar Surface Area: 205.48Molecular Species: NEUTRALHBA: 12HBD: 4
#RO5 Violations: 3HBA (Lipinski): 15HBD (Lipinski): 4#RO5 Violations (Lipinski): 3
CX Acidic pKa: 7.12CX Basic pKa: 4.32CX LogP: 5.21CX LogD: 4.83
Aromatic Rings: 6Heavy Atoms: 60QED Weighted: 0.08Np Likeness Score: -1.42

References

1. Tang P, Zhang J, Liu J, Chiang CM, Ouyang L..  (2021)  Targeting Bromodomain and Extraterminal Proteins for Drug Discovery: From Current Progress to Technological Development.,  64  (5.0): [PMID:33616410] [10.1021/acs.jmedchem.0c01487]
2. Zhou XL, Zhao F, Xu YT, Guan YY, Yu T, Zhang YZ, Duan YC, Zhao Y..  (2022)  A comprehensive review of BET-targeting PROTACs for cancer therapy.,  73  [PMID:36202064] [10.1016/j.bmc.2022.117033]

Source