ID: ALA5274368

Max Phase: Preclinical

Molecular Formula: C30H29FN3O4P

Molecular Weight: 545.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cn(C2CC2)c2cc(N3CCN(CP(=O)(c4ccccc4)c4ccccc4)CC3)c(F)cc2c1=O

Standard InChI:  InChI=1S/C30H29FN3O4P/c31-26-17-24-27(34(21-11-12-21)19-25(29(24)35)30(36)37)18-28(26)33-15-13-32(14-16-33)20-39(38,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-10,17-19,21H,11-16,20H2,(H,36,37)

Standard InChI Key:  KJWMCQQCTJFZHY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    0.8647    0.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5793    1.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2912    0.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2912   -0.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5811   -0.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8647   -0.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0058    1.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7205    0.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7205   -0.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0058   -0.4660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0058    2.0095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4351    1.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4351    2.0095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1498    0.7717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1501    1.1839    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.1501   -0.4697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1501   -1.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5644   -1.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2790   -1.2948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2791   -0.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5644   -0.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9937   -1.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7083   -1.2948    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5229   -1.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7083   -0.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4229   -0.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4222    0.7658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7073    1.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9954    0.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9906   -0.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0447   -1.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8567   -1.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1498   -0.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6320   -0.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8172   -0.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0058   -1.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1209   -2.0095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5925   -2.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4176   -2.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
  7 11  2  0
  8 12  1  0
 12 13  2  0
 12 14  1  0
  1 15  1  0
  6 16  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 16 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 31 24  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 24 35  1  0
 10 36  1  0
 23 37  2  0
 38 36  1  0
 38 39  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5274368

    ---

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CT26 (928 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.55Molecular Weight (Monoisotopic): 545.1880AlogP: 4.27#Rotatable Bonds: 7
Polar Surface Area: 82.85Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.33CX Basic pKa: 5.96CX LogP: 4.47CX LogD: 3.38
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -0.65

References

1. Ahadi H, Emami S..  (2020)  Modification of 7-piperazinylquinolone antibacterials to promising anticancer lead compounds: Synthesis and in vitro studies.,  187  [PMID:31881454] [10.1016/j.ejmech.2019.111970]

Source