methyl (1S,2S,4R,5S)-4,5-dihydroxy-2-(((1R,2S)-2-(((2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)carbamoyl)cyclohexyl)carbamoyl)cyclohexane-1-carboxylate

ID: ALA5274423

Max Phase: Preclinical

Molecular Formula: C22H36N2O10

Molecular Weight: 488.53

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H]1C[C@H](O)[C@H](O)C[C@@H]1C(=O)N[C@@H]1CCCC[C@@H]1C(=O)N[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C22H36N2O10/c1-9-16(27)17(28)18(29)21(34-9)24-19(30)10-5-3-4-6-13(10)23-20(31)11-7-14(25)15(26)8-12(11)22(32)33-2/h9-18,21,25-29H,3-8H2,1-2H3,(H,23,31)(H,24,30)/t9-,10-,11-,12-,13+,14+,15-,16+,17+,18-,21+/m0/s1

Standard InChI Key:  QLTCKBWZMPOMBQ-METYLVLHSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -1.0335    3.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7510    2.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7510    2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0456    1.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3281    2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0881    0.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0881   -0.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3586   -2.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0819   -3.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7931   -2.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0697   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3281    2.8814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3769    1.6388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3769    0.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8054    0.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5104    0.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5104   -0.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7932   -0.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3586   -0.8354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3586   -1.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3586   -2.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7931   -2.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0697   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7749   -0.4072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4921   -0.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3463   -0.4177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5104   -3.2885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0819   -4.1238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0698   -2.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3403    0.4069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0456    0.8244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4743    1.6598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4621    3.3095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0335    4.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  7  1  0
 10  9  1  0
  8 11  1  0
  5 12  1  0
  1 12  1  0
  5 13  1  1
 13 14  1  0
  6 14  1  1
 15  6  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
  7 18  1  0
  7 19  1  1
 19 20  1  0
  8 20  1  1
  9 21  1  0
 21  8  1  0
 22 10  1  0
 11 22  1  0
 11 23  1  6
 23 24  1  0
 24 25  1  0
 23 26  2  0
 10 27  1  1
  9 28  1  1
 20 29  2  0
 14 30  2  0
  4 31  1  1
  3 32  1  6
  2 33  1  6
  1 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5274423

    ---

Associated Targets(Human)

CLEC4M Tbio C-type lectin domain family 4 member M (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 488.53Molecular Weight (Monoisotopic): 488.2370AlogP: -2.47#Rotatable Bonds: 5
Polar Surface Area: 194.88Molecular Species: NEUTRALHBA: 10HBD: 7
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.47CX Basic pKa: CX LogP: -2.56CX LogD: -2.56
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.20Np Likeness Score: 0.75

References

1. Cramer J..  (2021)  Medicinal chemistry of the myeloid C-type lectin receptors Mincle, Langerin, and DC-SIGN.,  12  (12.0): [PMID:35024612] [10.1039/D1MD00238D]

Source