The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ugonstilbene B; (4aS,9aR)-6-((E)-4-Hydroxystyryl)-1,1,4a-trimethyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-8-ol ID: ALA5274515
Max Phase: Preclinical
Molecular Formula: C24H28O3
Molecular Weight: 364.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CCC[C@]2(C)Oc3cc(/C=C/c4ccc(O)cc4)cc(O)c3C[C@H]12
Standard InChI: InChI=1S/C24H28O3/c1-23(2)11-4-12-24(3)22(23)15-19-20(26)13-17(14-21(19)27-24)6-5-16-7-9-18(25)10-8-16/h5-10,13-14,22,25-26H,4,11-12,15H2,1-3H3/b6-5+/t22-,24+/m1/s1
Standard InChI Key: NVDNWXIJCXLGEI-LWZQCQJSSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-4.2864 0.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5720 0.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8574 0.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8574 -0.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5720 -1.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 -0.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 0.6211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4282 0.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4282 -0.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 -1.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7155 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0008 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 -0.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7104 -1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9854 -1.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1600 -1.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8574 1.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4447 -1.3311 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7104 -1.8559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 1.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8567 1.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5733 0.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8613 0.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 1.8557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
3 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
8 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
5 15 1 0
5 16 1 0
3 17 1 1
4 18 1 1
14 19 1 0
12 20 1 0
20 21 2 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 364.49Molecular Weight (Monoisotopic): 364.2038AlogP: 5.79#Rotatable Bonds: 2Polar Surface Area: 49.69Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.78CX Basic pKa: ┄CX LogP: 6.19CX LogD: 6.17Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.66Np Likeness Score: 2.03
References 1. Lin CT, Yang YH, Cheng JJ, Don MJ.. (2023) Total Syntheses, Absolute Configurations, and Cytotoxicity Evaluation of Ugonstilbenes A, B, and C from the Rhizomes of Helminthostachys zeylanica ., 86 (2.0): [PMID:36691388 ] [10.1021/acs.jnatprod.2c00919 ]