The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (Z)-(4-((3-(2-((benzyloxy)amino)-2-oxoethyl)-2,4-dioxothiazolidin-5-ylidene)methyl)benzoyl)-L-leucinate ID: ALA5274552
Max Phase: Preclinical
Molecular Formula: C27H29N3O7S
Molecular Weight: 539.61
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](CC(C)C)NC(=O)c1ccc(/C=C2\SC(=O)N(CC(=O)NOCc3ccccc3)C2=O)cc1
Standard InChI: InChI=1S/C27H29N3O7S/c1-17(2)13-21(26(34)36-3)28-24(32)20-11-9-18(10-12-20)14-22-25(33)30(27(35)38-22)15-23(31)29-37-16-19-7-5-4-6-8-19/h4-12,14,17,21H,13,15-16H2,1-3H3,(H,28,32)(H,29,31)/b22-14-/t21-/m0/s1
Standard InChI Key: HVTOXZYFQBTGIH-ODLJZMMESA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
-1.6970 -0.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4116 -0.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9851 -0.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9851 -1.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6952 -1.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4116 -1.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2705 -1.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4441 -1.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1975 -1.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7495 -1.0795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3371 -0.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5303 -0.5367 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7494 0.3489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4110 -2.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5742 -1.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9865 -0.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8112 -0.3653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5742 0.3488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2235 0.3488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0482 0.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4605 1.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1257 -0.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8400 -0.5322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1257 0.7048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5541 -0.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2683 -0.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9826 -0.1198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6967 -0.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2683 -1.3568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5541 0.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2683 1.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2683 1.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9826 0.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0484 1.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4601 2.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2851 2.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6967 1.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2888 1.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
2 6 1 0
4 7 1 0
7 8 2 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
12 8 1 0
11 13 2 0
9 14 2 0
10 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
2 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 2 0
25 30 1 6
30 31 1 0
31 32 1 0
31 33 1 0
34 21 2 0
35 34 1 0
36 35 2 0
37 36 1 0
38 37 2 0
21 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 539.61Molecular Weight (Monoisotopic): 539.1726AlogP: 3.29#Rotatable Bonds: 11Polar Surface Area: 131.11Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.57CX Basic pKa: ┄CX LogP: 3.36CX LogD: 2.47Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.17
References 1. Dak M, Šlachtová V, Šebela M, Bazgier V, Berka K, Smiejkowska N, Oorts L, Cappoen D, Brulíková L.. (2022) Novel heterocyclic hydroxamates as inhibitors of the mycobacterial zinc metalloprotease Zmp1 to probe its mechanism of function., 244 [PMID:36242986 ] [10.1016/j.ejmech.2022.114831 ]