The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(((Z)-(1-(2-aminothiazol-4-yl)-2-(((3S)-2-((3-((1,5-dihydroxy-4-oxo-1,4-dihydropyridin-2-yl)methyl)ureido)methyl)-4-oxo-1-sulfoazetidin-3-yl)amino)-2-oxoethylidene)amino)oxy)-2-methylpropanoic acid ID: ALA5274639
Max Phase: Preclinical
Molecular Formula: C20H24N8O12S2
Molecular Weight: 632.59
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O/N=C(\C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)C1CNC(=O)NCc1cc(=O)c(O)cn1O)c1csc(N)n1)C(=O)O
Standard InChI: InChI=1S/C20H24N8O12S2/c1-20(2,17(33)34)40-26-13(9-7-41-18(21)24-9)15(31)25-14-10(28(16(14)32)42(37,38)39)5-23-19(35)22-4-8-3-11(29)12(30)6-27(8)36/h3,6-7,10,14,30,36H,4-5H2,1-2H3,(H2,21,24)(H,25,31)(H,33,34)(H2,22,23,35)(H,37,38,39)/b26-13-/t10?,14-/m0/s1
Standard InChI Key: JLNPLWTWFIPBPD-LKVHSFBLSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
-0.4149 -0.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4149 -1.6069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2262 -1.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2262 -0.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8093 -2.1901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8093 -0.1986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6059 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1891 0.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8194 -1.2087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9856 -0.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9756 0.9675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1791 1.1810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9656 1.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1690 2.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9555 2.9877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5858 1.6079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1793 2.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7622 2.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2811 -0.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1044 -0.7689 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.3178 0.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6262 0.4762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.1144 0.2408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1681 -2.1901 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9649 -1.9766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4159 -2.7743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3806 -2.9877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1681 -0.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9649 -0.4122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5480 0.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3447 -0.0425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3346 0.9675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9279 0.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7245 0.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3076 0.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1041 0.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3177 -0.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7345 -0.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9380 -0.4693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1144 -0.3131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3548 -1.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6874 1.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 4 1 0
3 5 2 0
4 6 1 1
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
8 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
13 17 1 0
13 18 1 0
19 10 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 10 1 0
21 23 1 0
2 24 1 0
24 25 1 0
24 26 2 0
24 27 2 0
1 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
33 34 1 0
35 34 2 0
36 35 1 0
37 36 1 0
38 37 2 0
39 38 1 0
34 39 1 0
37 40 1 0
39 41 1 0
36 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 632.59Molecular Weight (Monoisotopic): 632.0955AlogP: -2.59#Rotatable Bonds: 11Polar Surface Area: 305.17Molecular Species: ACIDHBA: 15HBD: 8#RO5 Violations: 3HBA (Lipinski): 20HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: -1.64CX Basic pKa: 3.91CX LogP: -5.20CX LogD: -8.25Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.04Np Likeness Score: -0.08
References 1. Rayner B, Verderosa AD, Ferro V, Blaskovich MAT.. (2023) Siderophore conjugates to combat antibiotic-resistant bacteria., 14 (5): [PMID:37252105 ] [10.1039/d2md00465h ]