4-(N-((2R,3S)-3-(((((3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-yl)oxy)carbonyl)amino)-2-hydroxy-4-phenylbutyl)-N-isobutylsulfamoyl)benzoic acid

ID: ALA5274743

Max Phase: Preclinical

Molecular Formula: C28H36N2O9S

Molecular Weight: 576.67

Names and Identifiers

Canonical SMILES:  CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C28H36N2O9S/c1-18(2)15-30(40(35,36)21-10-8-20(9-11-21)26(32)33)16-24(31)23(14-19-6-4-3-5-7-19)29-28(34)39-25-17-38-27-22(25)12-13-37-27/h3-11,18,22-25,27,31H,12-17H2,1-2H3,(H,29,34)(H,32,33)/t22-,23-,24+,25-,27+/m0/s1

Standard InChI Key:  YSTCRWMBLFPEMC-GAYSTUHSSA-N

Molfile:  

 
     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   -0.8162    5.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9880    4.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2737    4.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8869    3.8160    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0615    3.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3511    2.8997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0610    2.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8860    2.1852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3516    1.4708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0605    0.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8855    0.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2978    0.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8851   -0.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2973   -1.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1223   -1.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5351   -0.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1228    0.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3521    0.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1771    0.0419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0601   -0.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3526   -1.3869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1279   -1.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7597   -1.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6162   -0.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5351   -1.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0596   -2.1016    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3530   -2.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0591   -3.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3535   -4.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1785   -4.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5912   -4.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1790   -5.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4162   -4.9589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5907   -3.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1780   -2.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8821    3.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0538    4.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3395    4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9528    5.4715    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042    5.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7756   -2.5149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7756   -1.6897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  1
  3  5  1  0
  5  6  1  6
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  1
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 10 18  1  0
 18 19  1  1
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 21 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 30 34  2  0
 34 35  1  0
 35 27  2  0
  5 36  1  0
 37 36  1  0
 38  3  1  0
 38 37  1  0
 38 39  1  1
  1 40  1  0
 40 38  1  0
 26 41  2  0
 26 42  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA5274743

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type:

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 576.67

Molecular Weight (Monoisotopic): 576.2142

AlogP: 2.49

#Rotatable Bonds: 12

Polar Surface Area: 151.70

Molecular Species: ACID

HBA: 8

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.53

CX Basic pKa: ┄

CX LogP: 3.30

CX LogD: -0.06

Aromatic Rings: 2

Heavy Atoms: 40

QED Weighted: 0.35

Np Likeness Score: 0.10

References

1. Plescia J, Moitessier N..  (2020)  Design and discovery of boronic acid drugs.,  195  [PMID:32302879] [10.1016/j.ejmech.2020.112270]

2. Ghosh AK, Osswald HL, Prato G..  (2016)  Recent Progress in the Development of HIV-1 Protease Inhibitors for the Treatment of HIV/AIDS.,  59  (11): [PMID:26799988] [10.1021/acs.jmedchem.5b01697]

3. Ghosh AK, Shahabi D, Kipfmiller M, Ghosh AK, Johnson M, Wang YF, Agniswamy J, Amano M, Weber IT, Mitsuya H..  (2023)  Evaluation of darunavir-derived HIV-1 protease inhibitors incorporating P2' amide-derivatives: Synthesis, biological evaluation and structural studies.,  83  [PMID:36738797] [10.1016/j.bmcl.2023.129168]

Source

Source(1):

• Scientific Literature