(S,E)-2-(4-Oxyranphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one

ID: ALA5275141

Max Phase: Preclinical

Molecular Formula: C19H18O6

Molecular Weight: 342.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)O[C@H](c1ccc(OCC3CO3)cc1)CC2=O

Standard InChI:  InChI=1S/C19H18O6/c1-22-13-6-15(20)19-16(21)8-17(25-18(19)7-13)11-2-4-12(5-3-11)23-9-14-10-24-14/h2-7,14,17,20H,8-10H2,1H3/t14?,17-/m0/s1

Standard InChI Key:  GURXROVSJOIFPP-JRZJBTRGSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -3.2690   -0.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5544    0.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8425   -0.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8425   -0.9734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5526   -1.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2690   -0.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5526   -2.2104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1247   -1.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4131   -0.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4149   -0.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1298    0.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2997    0.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2999    1.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0128    1.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7276    1.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7292    0.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0174   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4422    1.4985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1247   -2.2127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9836    0.2639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6982   -0.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1569    1.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8715    1.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6982    1.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2849    2.2127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  3 11  1  0
 10 12  1  6
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 15 18  1  0
  8 19  2  0
  1 20  1  0
 20 21  1  0
 18 22  1  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 23 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275141

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 342.35Molecular Weight (Monoisotopic): 342.1103AlogP: 2.88#Rotatable Bonds: 5
Polar Surface Area: 77.52Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.69CX Basic pKa: CX LogP: 2.97CX LogD: 2.95
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.84Np Likeness Score: 1.13

References

1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU..  (2020)  Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer.,  28  (23.0): [PMID:33038666] [10.1016/j.bmc.2020.115798]

Source