The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-6-amino-1-(((S)-5-guanidino-1-oxopentan-2-yl)amino)-1-oxohexan-2-yl)-1H-imidazole-2-carboxamide ID: ALA5275144
Max Phase: Preclinical
Molecular Formula: C16H28N8O3
Molecular Weight: 380.45
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](C=O)NC(=O)[C@H](CCCCN)NC(=O)c1ncc[nH]1
Standard InChI: InChI=1S/C16H28N8O3/c17-6-2-1-5-12(24-15(27)13-20-8-9-21-13)14(26)23-11(10-25)4-3-7-22-16(18)19/h8-12H,1-7,17H2,(H,20,21)(H,23,26)(H,24,27)(H4,18,19,22)/t11-,12-/m0/s1
Standard InChI Key: ABABZXRMQLDWSA-RYUDHWBXSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
2.4387 -3.7124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1532 -3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8676 -3.7124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1532 -2.4749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4387 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4387 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7242 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7242 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4387 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4387 1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0098 0.4124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2953 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2953 -0.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4191 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4191 1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2953 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2953 2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0098 2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0098 3.7124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1335 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8480 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8480 1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6486 -0.8200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4552 -0.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8676 -0.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3157 0.3353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
4 2 1 0
5 4 1 0
6 5 1 0
7 6 1 0
8 7 1 6
8 9 1 0
9 10 2 0
11 8 1 0
12 11 1 0
12 13 2 0
14 12 1 0
14 15 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 14 1 0
21 20 1 0
21 22 2 0
23 21 1 0
24 23 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.45Molecular Weight (Monoisotopic): 380.2284AlogP: -1.42#Rotatable Bonds: 13Polar Surface Area: 191.87Molecular Species: BASEHBA: 6HBD: 7#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 9#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.62CX Basic pKa: 12.02CX LogP: -3.17CX LogD: -7.27Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.09Np Likeness Score: 0.43