N-((S)-6-amino-1-(((S)-5-guanidino-1-oxopentan-2-yl)amino)-1-oxohexan-2-yl)-1H-imidazole-2-carboxamide

ID: ALA5275144

Max Phase: Preclinical

Molecular Formula: C16H28N8O3

Molecular Weight: 380.45

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H](C=O)NC(=O)[C@H](CCCCN)NC(=O)c1ncc[nH]1

Standard InChI:  InChI=1S/C16H28N8O3/c17-6-2-1-5-12(24-15(27)13-20-8-9-21-13)14(26)23-11(10-25)4-3-7-22-16(18)19/h8-12H,1-7,17H2,(H,20,21)(H,23,26)(H,24,27)(H4,18,19,22)/t11-,12-/m0/s1

Standard InChI Key:  ABABZXRMQLDWSA-RYUDHWBXSA-N

Molfile:  

 
     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
    2.4387   -3.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1532   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8676   -3.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1532   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4387   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4387   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7242   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7242   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4387    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4387    1.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0098    0.4124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2953   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2953   -0.8249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4191    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4191    1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2953    1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2953    2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0098    2.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0098    3.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1335   -0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8480    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8480    1.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5625   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6486   -0.8200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4552   -0.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8676   -0.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3157    0.3353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  4  2  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  6
  8  9  1  0
  9 10  2  0
 11  8  1  0
 12 11  1  0
 12 13  2  0
 14 12  1  0
 14 15  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 14  1  0
 21 20  1  0
 21 22  2  0
 23 21  1  0
 24 23  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275144

    ---

Associated Targets(non-human)

Genome polyprotein (620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 380.45Molecular Weight (Monoisotopic): 380.2284AlogP: -1.42#Rotatable Bonds: 13
Polar Surface Area: 191.87Molecular Species: BASEHBA: 6HBD: 7
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 9#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.62CX Basic pKa: 12.02CX LogP: -3.17CX LogD: -7.27
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.09Np Likeness Score: 0.43

References

1. Voss S, Nitsche C..  (2021)  Targeting the protease of West Nile virus.,  12  (8.0): [PMID:34458734] [10.1039/D1MD00080B]

Source