ethyl (R)-1-((2,3-di(furan-2-yl)quinoxalin-6-yl)carbamoyl)piperidine-3-carboxylate

ID: ALA5275318

Max Phase: Preclinical

Molecular Formula: C25H24N4O5

Molecular Weight: 460.49

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@@H]1CCCN(C(=O)Nc2ccc3nc(-c4ccco4)c(-c4ccco4)nc3c2)C1

Standard InChI:  InChI=1S/C25H24N4O5/c1-2-32-24(30)16-6-3-11-29(15-16)25(31)26-17-9-10-18-19(14-17)28-23(21-8-5-13-34-21)22(27-18)20-7-4-12-33-20/h4-5,7-10,12-14,16H,2-3,6,11,15H2,1H3,(H,26,31)/t16-/m1/s1

Standard InChI Key:  NECLHCRBSCDVPV-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -3.6155    0.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6155   -0.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9021   -0.9406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1950   -0.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1950    0.2910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9039    0.7012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4854    0.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7734    0.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7734   -0.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4803   -0.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0623    0.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6487    0.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3600    0.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3600    1.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0711    1.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7823    1.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7823    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0711    0.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4935    0.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2046    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9158    0.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6270    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4935   -0.5317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6487   -0.5317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3267   -0.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0764   -0.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6257   -1.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2153   -1.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4124   -1.7611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3271    0.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4129    1.5183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2163    1.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6270    0.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0773    0.3675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 17 19  1  1
 19 20  1  0
 20 21  1  0
 21 22  1  0
 19 23  2  0
 12 24  2  0
 25  2  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 25 29  1  0
 30  1  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275318

    ---

Associated Targets(Human)

PPIA Tclin Cyclophilin A (674 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPID Tchem Peptidyl-prolyl cis-trans isomerase D (111 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.49Molecular Weight (Monoisotopic): 460.1747AlogP: 4.96#Rotatable Bonds: 5
Polar Surface Area: 110.70Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.08CX Basic pKa: CX LogP: 3.57CX LogD: 3.57
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.51

References

1. Dunyak BM, Gestwicki JE..  (2016)  Peptidyl-Proline Isomerases (PPIases): Targets for Natural Products and Natural Product-Inspired Compounds.,  59  (21): [PMID:27409354] [10.1021/acs.jmedchem.6b00411]

Source