The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl (R)-1-((2,3-di(furan-2-yl)quinoxalin-6-yl)carbamoyl)piperidine-3-carboxylate ID: ALA5275318
Max Phase: Preclinical
Molecular Formula: C25H24N4O5
Molecular Weight: 460.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@@H]1CCCN(C(=O)Nc2ccc3nc(-c4ccco4)c(-c4ccco4)nc3c2)C1
Standard InChI: InChI=1S/C25H24N4O5/c1-2-32-24(30)16-6-3-11-29(15-16)25(31)26-17-9-10-18-19(14-17)28-23(21-8-5-13-34-21)22(27-18)20-7-4-12-33-20/h4-5,7-10,12-14,16H,2-3,6,11,15H2,1H3,(H,26,31)/t16-/m1/s1
Standard InChI Key: NECLHCRBSCDVPV-MRXNPFEDSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-3.6155 0.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6155 -0.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9021 -0.9406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1950 -0.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1950 0.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9039 0.7012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4854 0.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7734 0.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7734 -0.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4803 -0.9429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0623 0.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6487 0.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3600 0.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3600 1.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0711 1.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7823 1.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7823 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0711 0.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4935 0.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2046 0.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9158 0.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6270 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4935 -0.5317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6487 -0.5317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3267 -0.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0764 -0.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6257 -1.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2153 -1.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4124 -1.7611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3271 0.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4129 1.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2163 1.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6270 0.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0773 0.3675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
17 19 1 1
19 20 1 0
20 21 1 0
21 22 1 0
19 23 2 0
12 24 2 0
25 2 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
25 29 1 0
30 1 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
30 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.49Molecular Weight (Monoisotopic): 460.1747AlogP: 4.96#Rotatable Bonds: 5Polar Surface Area: 110.70Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.08CX Basic pKa: ┄CX LogP: 3.57CX LogD: 3.57Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.51
References 1. Dunyak BM, Gestwicki JE.. (2016) Peptidyl-Proline Isomerases (PPIases): Targets for Natural Products and Natural Product-Inspired Compounds., 59 (21): [PMID:27409354 ] [10.1021/acs.jmedchem.6b00411 ]