4-(3,5-Bis(4-(aminomethyl)phenoxy)phenoxy)-benzimidamide

ID: ALA5275339

Max Phase: Preclinical

Molecular Formula: C27H26N4O3

Molecular Weight: 454.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)c1ccc(Oc2cc(Oc3ccc(CN)cc3)cc(Oc3ccc(CN)cc3)c2)cc1

Standard InChI:  InChI=1S/C27H26N4O3/c28-16-18-1-7-21(8-2-18)32-24-13-25(33-22-9-3-19(17-29)4-10-22)15-26(14-24)34-23-11-5-20(6-12-23)27(30)31/h1-15H,16-17,28-29H2,(H3,30,31)

Standard InChI Key:  HZPZADBHSBTKBW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -1.0699    2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3553    2.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3564    2.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3564    1.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3536    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0699    1.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0710    2.4742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    2.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7845    2.4738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4991    2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3536   -0.0003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3609   -0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5003    2.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124    2.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124    1.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5021    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    1.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993    1.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2121    0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9269    1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9285    2.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2168    2.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0757   -0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7877   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7877   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0775   -1.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3609   -1.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6415    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6415    0.0004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5023   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2169   -1.2378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9269    0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6415    1.2366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5023   -2.4755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  1  0
  1  9  1  0
  9 10  1  0
  5 11  1  0
 11 12  1  0
 13  8  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
  8 17  1  0
 18 10  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 10 22  1  0
 23 12  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 12 27  1  0
 20 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  2  0
 15 32  1  0
 32 33  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275339

    ---

Associated Targets(Human)

ST14 Tchem Matriptase (677 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.2005AlogP: 5.26#Rotatable Bonds: 9
Polar Surface Area: 129.60Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 11.67CX LogP: 3.65CX LogD: -2.44
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.20Np Likeness Score: -0.06

References

1. Hammerschmidt SJ, Maus H, Weldert AC, Gütschow M, Kersten C..  (2023)  Improving binding entropy by higher ligand symmetry? - A case study with human matriptase.,  14  (5): [PMID:37252099] [10.1039/d3md00125c]

Source