(4aS,6aR,6bR,8aR,9S,10R,11R,12aS,12bR,14aR,14bR)-10,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,14a,14b-icosahydropicene-4a-carboxylic acid

ID: ALA5275505

Max Phase: Preclinical

Molecular Formula: C30H48O5

Molecular Weight: 488.71

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](C=C[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@](C)(CO)[C@@H]5CC[C@]43C)[C@H]2C1

Standard InChI:  InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7-8,18-23,31-33H,9-17H2,1-6H3,(H,34,35)/t18-,19-,20-,21-,22-,23+,26+,27-,28-,29-,30+/m1/s1

Standard InChI Key:  PXYDPGTULGLUMF-SBAYXHKCSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -2.8335   -0.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1190   -0.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046   -0.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046   -1.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1190   -1.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8335   -1.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6902   -0.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0241   -0.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0241   -1.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6902   -1.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6902    0.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0242    0.9730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385    0.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385   -0.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4531    0.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1676    0.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1676   -0.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4530   -0.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4532    1.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1677    2.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8822    1.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8821    0.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5842    2.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5802    2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7511   -0.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5482    0.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5376   -0.8202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8696    1.5564    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0241    0.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6902   -1.0895    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046    0.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7026   -2.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9055   -2.7113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5482   -0.2643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5482   -1.9144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046   -2.3270    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385   -1.0895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385    1.3856    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1084   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  7 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  1  0
  8 14  1  0
 13 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 14 18  1  0
 15 19  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 16 22  1  0
 20 23  1  0
 20 24  1  0
 16 25  1  1
 25 26  2  0
 25 27  1  0
 15 28  1  6
  8 29  1  1
  7 30  1  6
  3 31  1  1
  5 32  1  0
  5 33  1  1
  1 34  1  6
  6 35  1  1
  4 36  1  6
 14 37  1  6
 13 38  1  1
 33 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275505

    ---

Associated Targets(non-human)

Hepatocyte (1455 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.71Molecular Weight (Monoisotopic): 488.3502AlogP: 5.03#Rotatable Bonds: 2
Polar Surface Area: 97.99Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.75CX Basic pKa: CX LogP: 4.28CX LogD: 1.68
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: 2.93

References

1. Xu GB, Xiao YH, Zhang QY, Zhou M, Liao SG..  (2018)  Hepatoprotective natural triterpenoids.,  145  [PMID:29353722] [10.1016/j.ejmech.2018.01.011]

Source