Tetraisopropyl 2-(2-tert-butyl-6-(heptan-3-yl)pyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5275570

Max Phase: Preclinical

Molecular Formula: C30H57NO6P2

Molecular Weight: 589.74

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC(CC)c1cc(CC(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(C(C)(C)C)n1

Standard InChI:  InChI=1S/C30H57NO6P2/c1-14-16-17-26(15-2)27-18-25(19-28(31-27)30(11,12)13)20-29(38(32,34-21(3)4)35-22(5)6)39(33,36-23(7)8)37-24(9)10/h18-19,21-24,26,29H,14-17,20H2,1-13H3

Standard InChI Key:  KTYYMUJLVLBTCG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 39  0  0  0  0  0  0  0  0999 V2000
   -2.4991    0.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7846    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0702    0.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0702   -0.6639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3540   -1.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3540   -1.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3540   -2.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0684   -2.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3603   -2.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3558   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3558    0.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702    0.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846    0.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846   -0.6602    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.5703   -1.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7731   -1.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1898   -1.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5588   -2.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9863   -0.8741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991   -1.0727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991   -1.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846   -2.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2134   -2.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991    0.5770    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.0874    1.2928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9123    1.2928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    2.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6749    2.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9123    2.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2134    0.1646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9279    0.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9279    1.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6424    0.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    0.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7846    1.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4991    1.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2134    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9279    0.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6424    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  6  9  1  0
  5 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 14 19  2  0
 14 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 13 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 24 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 11 34  1  0
 34  3  2  0
  2 35  1  0
 35 36  1  0
  1 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275570

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 589.74Molecular Weight (Monoisotopic): 589.3661AlogP: 10.02#Rotatable Bonds: 17
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.53CX LogP: 8.62CX LogD: 8.61
Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: -0.09

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source