N-(2-(1H-indol-3-yl)ethyl)-7-hydroxy-5-oxo-5H-thiazolo[3,2-a]pyrimidine-6-carboxamide

ID: ALA5275617

Max Phase: Preclinical

Molecular Formula: C17H14N4O3S

Molecular Weight: 354.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCc1c[nH]c2ccccc12)c1c(O)nc2sccn2c1=O

Standard InChI:  InChI=1S/C17H14N4O3S/c22-14(13-15(23)20-17-21(16(13)24)7-8-25-17)18-6-5-10-9-19-12-4-2-1-3-11(10)12/h1-4,7-9,19,23H,5-6H2,(H,18,22)

Standard InChI Key:  VJNNBHXVPIDOHO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -2.7930   -1.3975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2752   -0.7280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7712   -0.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9694   -0.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9694   -1.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2375    0.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5055   -0.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2264    0.1264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9583   -0.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6902    0.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6902    0.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4221    1.3972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1512    0.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9749    1.2316    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4571    0.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9531   -0.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1512    0.1301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4240   -0.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4240   -1.1367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9583   -1.1413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9583    1.3975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1167   -0.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4571    0.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9572    0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1131    0.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  5  1  1  0
  6  4  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 17 13  1  0
 18 17  1  0
 10 18  1  0
 18 19  2  0
  9 20  2  0
 11 21  1  0
  2 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
  3 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275617

    ---

Associated Targets(Human)

CLEC4M Tbio C-type lectin domain family 4 member M (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 354.39Molecular Weight (Monoisotopic): 354.0787AlogP: 1.92#Rotatable Bonds: 4
Polar Surface Area: 99.49Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.99CX Basic pKa: CX LogP: 2.14CX LogD: 2.04
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.52Np Likeness Score: -1.47

References

1. Sethi A, Sanam S, Alvala M..  (2021)  Non-carbohydrate strategies to inhibit lectin proteins with special emphasis on galectins.,  222  [PMID:34146913] [10.1016/j.ejmech.2021.113561]

Source