Tetrakis(cyclopropylmethyl) 2-(2,6-di-tert-butylpyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5275694

Max Phase: Preclinical

Molecular Formula: C31H51NO6P2

Molecular Weight: 595.70

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1cc(CC(P(=O)(OCC2CC2)OCC2CC2)P(=O)(OCC2CC2)OCC2CC2)cc(C(C)(C)C)n1

Standard InChI:  InChI=1S/C31H51NO6P2/c1-30(2,3)27-15-26(16-28(32-27)31(4,5)6)17-29(39(33,35-18-22-7-8-22)36-19-23-9-10-23)40(34,37-20-24-11-12-24)38-21-25-13-14-25/h15-16,22-25,29H,7-14,17-21H2,1-6H3

Standard InChI Key:  GCWMSMACUOJXCO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   -3.9834    0.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2689    0.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2689    1.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9834    0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5543    0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5543   -0.8056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8382   -1.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8382   -2.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8382   -2.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5527   -2.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1238   -2.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1283   -0.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1283    0.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4138    0.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3006    0.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3006   -0.8018    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.0861   -1.5986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7109   -1.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9253   -2.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5103   -3.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7136   -3.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4978   -1.0158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0149   -1.2144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0149   -2.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7295   -2.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5545   -2.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0149    0.4355    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.6032    1.1512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    1.1512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0157    1.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    2.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    2.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    3.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7295    0.0230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4439    0.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1584    0.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5717   -0.6927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9834    0.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8400    0.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
  5  2  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  7 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  1  0
 19 21  1  0
 16 22  2  0
 16 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  0
 26 27  1  0
 25 27  1  0
 15 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 33 32  1  0
 33 34  1  0
 32 34  1  0
 28 35  1  0
 35 36  1  0
 36 37  1  0
 38 37  1  0
 38 39  1  0
 37 39  1  0
 13 40  1  0
 40  5  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5275694

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.70Molecular Weight (Monoisotopic): 595.3192AlogP: 8.64#Rotatable Bonds: 16
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.43CX LogP: 7.50CX LogD: 7.50
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -0.14

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source