The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methoxycarbonylamino]-3-carboxy-propanoyl]amino]butanedioic acid ID: ALA5275771
Max Phase: Preclinical
Molecular Formula: C19H23N7O12
Molecular Weight: 541.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C19H23N7O12/c20-14-11-15(22-4-21-14)26(5-23-11)17-13(32)12(31)8(38-17)3-37-19(36)25-6(1-9(27)28)16(33)24-7(18(34)35)2-10(29)30/h4-8,12-13,17,31-32H,1-3H2,(H,24,33)(H,25,36)(H,27,28)(H,29,30)(H,34,35)(H2,20,21,22)/t6-,7-,8+,12+,13+,17+/m0/s1
Standard InChI Key: RPNITVPSKXJRML-ZFXBFDPNSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
2.9479 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5354 -0.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7406 -0.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6164 0.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3437 0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9270 0.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7239 0.4232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5572 1.5898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3644 1.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0805 1.4329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7905 1.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7905 2.6696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0787 3.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0787 3.9063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3644 2.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5785 2.9160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0847 2.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1572 -0.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3604 -0.7761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2229 -1.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0198 -1.1459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6031 -1.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3999 -1.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9832 -2.0991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7801 -1.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3634 -2.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1499 -3.2657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7332 -3.8490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3530 -3.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9936 -1.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7905 -0.8752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4103 -0.5054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6134 -0.7189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3895 -2.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9729 -3.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7593 -3.9063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7697 -2.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0094 -2.1563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
4 3 1 0
5 4 1 0
6 5 1 0
6 2 1 0
6 7 1 6
5 8 1 1
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
13 15 2 0
15 9 1 0
15 16 1 0
16 17 2 0
8 17 1 0
3 18 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 1
26 27 1 0
27 28 1 0
27 29 2 0
25 30 1 0
30 31 1 0
30 32 2 0
23 33 2 0
22 34 1 1
34 35 1 0
35 36 2 0
35 37 1 0
20 38 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.43Molecular Weight (Monoisotopic): 541.1405AlogP: -3.36#Rotatable Bonds: 11Polar Surface Area: 298.64Molecular Species: ACIDHBA: 14HBD: 8#RO5 Violations: 3HBA (Lipinski): 19HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 2.91CX Basic pKa: 4.69CX LogP: -4.99CX LogD: -12.67Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: 0.70
References 1. Conroy S, Kindon N, Kellam B, Stocks MJ.. (2016) Drug-like Antagonists of P2Y Receptors-From Lead Identification to Drug Development., 59 (22): [PMID:27413802 ] [10.1021/acs.jmedchem.5b01972 ]