(5S,11aR)-9-chloro-2-cyclohexyl-5-(4-methoxyphenyl)-3-thioxo-2,3,5,6,11,11a-hexahydro-1H-imidazo[1',5':1,6]pyrido[3,4-b]indol-1-one

ID: ALA5275789

Max Phase: Preclinical

Molecular Formula: C26H26ClN3O2S

Molecular Weight: 480.03

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc([C@H]2c3[nH]c4ccc(Cl)cc4c3C[C@@H]3C(=O)N(C4CCCCC4)C(=S)N23)cc1

Standard InChI:  InChI=1S/C26H26ClN3O2S/c1-32-18-10-7-15(8-11-18)24-23-20(19-13-16(27)9-12-21(19)28-23)14-22-25(31)29(26(33)30(22)24)17-5-3-2-4-6-17/h7-13,17,22,24,28H,2-6,14H2,1H3/t22-,24+/m1/s1

Standard InChI Key:  KDLUISXYQXUZPG-VWNXMTODSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   -3.3906    0.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6760    0.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9642    0.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9642   -0.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6742   -1.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3906   -0.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1794   -1.0670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1794    0.2679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6944   -0.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8436    1.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0230    1.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4619    0.4403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1262   -0.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5387   -1.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3641   -1.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7748   -1.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3620   -2.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5409   -2.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1244   -1.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7746   -3.1707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5998   -3.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2467    0.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4620    1.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2467    1.5203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9614    1.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9614    2.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6760    3.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3906    2.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3906    1.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6760    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2484    2.5724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9613    0.2826    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4356    1.8225    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1050    0.4252    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  8 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  9 13  1  0
 13 14  1  1
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 14 19  1  0
 19 18  2  0
 17 20  1  0
 20 21  1  0
 12 22  1  0
 11 23  1  0
 23 24  1  0
 24 22  1  0
 25 24  1  0
 25 26  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 25 30  1  0
 30 29  1  0
 23 31  2  0
 22 32  2  0
 11 33  1  1
  1 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275789

    ---

Associated Targets(Human)

DHODH Tclin Dihydroorotate dehydrogenase (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.03Molecular Weight (Monoisotopic): 479.1434AlogP: 5.61#Rotatable Bonds: 3
Polar Surface Area: 48.57Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.85CX Basic pKa: CX LogP: 5.91CX LogD: 5.91
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.54

References

1. Baiazitov RY, Qi H, Arasu T, Lennox W, Cao L, Weetall M, Furia B, Zhuo J, Choi S, Kim MJ, Sheedy J, Davis T, Moon YC..  (2022)  SAR studies toward discovery of emvododstat (PTC299), a potent dihydroorotate dehydrogenase (DHODH) inhibitor.,  244  [PMID:36242990] [10.1016/j.ejmech.2022.114826]

Source