Tetraisopropyl 2-(2-tert-butyl-6-isopropylpyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5275821

Max Phase: Preclinical

Molecular Formula: C26H49NO6P2

Molecular Weight: 533.63

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)OP(=O)(OC(C)C)C(Cc1cc(C(C)C)nc(C(C)(C)C)c1)P(=O)(OC(C)C)OC(C)C

Standard InChI:  InChI=1S/C26H49NO6P2/c1-17(2)23-14-22(15-24(27-23)26(11,12)13)16-25(34(28,30-18(3)4)31-19(5)6)35(29,32-20(7)8)33-21(9)10/h14-15,17-21,25H,16H2,1-13H3

Standard InChI Key:  FGIBTBHZTYGIIV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 35  0  0  0  0  0  0  0  0999 V2000
   -3.5709    0.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1419    0.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1419   -0.6639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -1.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -1.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -2.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7113   -2.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013    0.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -0.6602    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.4986   -1.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2984   -1.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5128   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8818   -1.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0852   -0.8741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -1.0727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -1.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420   -2.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -2.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275    0.5772    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.0158    1.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8408    1.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    2.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8408    2.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6032    2.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420    0.1647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    0.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5709    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    1.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4275    0.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564    1.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  6  9  1  0
  5 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 14 19  2  0
 14 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 13 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 24 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 11 34  1  0
 34  3  2  0
  2 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275821

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.63Molecular Weight (Monoisotopic): 533.3035AlogP: 8.46#Rotatable Bonds: 13
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.61CX LogP: 6.94CX LogD: 6.93
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -0.31

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source