(4E)-3-amino-4-{[3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-5-yl]methylidene}-5-oxo-4,5-dihydro-1H-pyrazole-1-carbothioamide

ID: ALA5275831

Max Phase: Preclinical

Molecular Formula: C20H15ClN6OS

Molecular Weight: 422.90

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=S)N1N=C(N)/C(=C\c2cc(-c3ccc(Cl)cc3)nn2-c2ccccc2)C1=O

Standard InChI:  InChI=1S/C20H15ClN6OS/c21-13-8-6-12(7-9-13)17-11-15(26(24-17)14-4-2-1-3-5-14)10-16-18(22)25-27(19(16)28)20(23)29/h1-11H,(H2,22,25)(H2,23,29)/b16-10+

Standard InChI Key:  HWLPLACBMBIRRJ-MHWRWJLKSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -0.6840   -1.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1305   -1.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0573   -1.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6815   -0.3578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8723   -1.2199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0027   -2.0345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2683   -2.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1406   -3.2253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7174   -2.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7174   -3.2723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4320   -2.0345    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.6509   -1.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565   -0.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0185   -0.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6915   -0.4690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4701   -1.2683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0536   -1.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8508   -1.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4320   -2.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2183   -3.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4256   -3.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8391   -2.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0185    0.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3039    1.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3047    2.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0195    2.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7314    2.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7362    1.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0195    3.2723    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  3  5  2  0
  6  5  1  0
  7  6  1  0
  1  7  1  0
  7  8  2  0
  6  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 12 16  1  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 17 22  1  0
 22 21  2  0
 14 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5275831

    ---

Associated Targets(Human)

AKR1B1 Tclin Aldose reductase (1404 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.90Molecular Weight (Monoisotopic): 422.0717AlogP: 2.93#Rotatable Bonds: 3
Polar Surface Area: 102.53Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.62CX Basic pKa: 1.46CX LogP: 3.81CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.32

References

1. Zhao Z, Dai X, Li C, Wang X, Tian J, Feng Y, Xie J, Ma C, Nie Z, Fan P, Qian M, He X, Wu S, Zhang Y, Zheng X..  (2020)  Pyrazolone structural motif in medicinal chemistry: Retrospect and prospect.,  186  [PMID:31761383] [10.1016/j.ejmech.2019.111893]

Source