The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5276014
Max Phase: Preclinical
Molecular Formula: C29H29FN3O4P
Molecular Weight: 533.54
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CP(=O)(c4ccccc4)c4ccccc4)CC3)cc21
Standard InChI: InChI=1S/C29H29FN3O4P/c1-2-32-19-24(29(35)36)28(34)23-17-25(30)27(18-26(23)32)33-15-13-31(14-16-33)20-38(37,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,17-19H,2,13-16,20H2,1H3,(H,35,36)
Standard InChI Key: FTEBXUKGRHXFLN-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
0.8647 0.7714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5794 1.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2913 0.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2913 -0.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8647 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0059 1.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7206 0.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7206 -0.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0059 -0.4660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0059 2.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4353 1.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4353 2.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1500 0.7717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1501 1.1839 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.1501 -0.4697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1501 -1.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5645 -1.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2792 -1.2949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2792 -0.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5645 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9938 -1.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7085 -1.2949 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-3.5230 -1.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7085 -0.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4231 -0.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4223 0.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7074 1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9955 0.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9907 -0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0449 -1.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8569 -1.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1500 -0.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6322 -0.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8174 -0.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0059 -1.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7206 -1.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1211 -2.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
7 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
1 15 1 0
6 16 1 0
17 16 1 0
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
16 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
31 24 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
24 35 1 0
10 36 1 0
36 37 1 0
23 38 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.54Molecular Weight (Monoisotopic): 533.1880AlogP: 3.95#Rotatable Bonds: 7Polar Surface Area: 82.85Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.34CX Basic pKa: 5.96CX LogP: 4.43CX LogD: 3.34Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.36Np Likeness Score: -0.79
References 1. Ahadi H, Emami S.. (2020) Modification of 7-piperazinylquinolone antibacterials to promising anticancer lead compounds: Synthesis and in vitro studies., 187 [PMID:31881454 ] [10.1016/j.ejmech.2019.111970 ]