2-benzyl-7-(furan-2-yl)-3-morpholino-6-((tetrahydrofuran-2-yl)methyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one

ID: ALA5276057

Max Phase: Preclinical

Molecular Formula: C27H29N3O4

Molecular Weight: 459.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1c2cc(N3CCOCC3)c(Cc3ccccc3)nc2C(c2ccco2)N1CC1CCCO1

Standard InChI:  InChI=1S/C27H29N3O4/c31-27-21-17-23(29-10-14-32-15-11-29)22(16-19-6-2-1-3-7-19)28-25(21)26(24-9-5-13-34-24)30(27)18-20-8-4-12-33-20/h1-3,5-7,9,13,17,20,26H,4,8,10-12,14-16,18H2

Standard InChI Key:  PCNWZKKIDPXVEP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    0.6778   -0.2105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3924    0.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3895    1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6760    1.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0350    0.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0337    1.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8196    1.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3066    0.6164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8216   -0.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0773   -0.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8602   -1.0928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8614   -1.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0792   -2.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5947   -1.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1294    0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5397    1.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2022    2.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8128    2.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5260    2.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3560    1.4191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0726    2.0675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1020    1.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8159    1.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5248    1.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5260    2.2645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8120    2.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0969    2.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1056   -0.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1069   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3937   -1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3946   -2.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1084   -2.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8226   -2.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8182   -1.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  1  1  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
  7 21  2  0
  3 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 22 27  1  0
 26 27  1  0
  2 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5276057

    ---

Associated Targets(non-human)

Vero C1008 (1716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.55Molecular Weight (Monoisotopic): 459.2158AlogP: 3.83#Rotatable Bonds: 6
Polar Surface Area: 68.04Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 12.19CX Basic pKa: 2.30CX LogP: 3.16CX LogD: 3.16
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -0.87

References

1. Morales-Salazar I, Montes-Enríquez FP, Garduño-Albino CE, García-Sánchez MA, Ibarra IA, Rojas-Aguirre Y, García-Hernández ME, Sarmiento-Silva RE, Alcaraz-Estrada SL, Díaz-Cervantes E, González-Zamora E, Islas-Jácome A..  (2023)  Synthesis of bis-furyl-pyrrolo[3,4-b]pyridin-5-ones via Ugi-Zhu reaction and in vitro activity assays against human SARS-CoV-2 and in silico studies on its main proteins.,  14  (1.0): [PMID:36760742] [10.1039/d2md00350c]

Source