1,2-bis(3,5-dimethoxyphenyl)ethane

ID: ALA5276116

Max Phase: Preclinical

Molecular Formula: C18H22O4

Molecular Weight: 302.37

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CCc2cc(OC)cc(OC)c2)cc(OC)c1

Standard InChI:  InChI=1S/C18H22O4/c1-19-15-7-13(8-16(11-15)20-2)5-6-14-9-17(21-3)12-18(10-14)22-4/h7-12H,5-6H2,1-4H3

Standard InChI Key:  JMNPTZPSNHUERJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   -2.2730   -1.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6849   -0.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2733    0.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4475    0.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0313   -0.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4438   -1.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2054   -0.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2074    0.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0333    0.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4464    1.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2698    1.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6828    0.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2733   -0.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4479   -0.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6863    1.0707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5121    1.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6859   -1.7872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2730   -2.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6827    1.7872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2698    2.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6862   -1.0710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5121   -1.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
  3 15  1  0
 15 16  1  0
  1 17  1  0
 17 18  1  0
 11 19  1  0
 19 20  1  0
 13 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5276116

    ---

Associated Targets(Human)

AKR1B1 Tclin Aldose reductase (1404 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 302.37Molecular Weight (Monoisotopic): 302.1518AlogP: 3.51#Rotatable Bonds: 7
Polar Surface Area: 36.92Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.88CX LogD: 3.88
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.78Np Likeness Score: 0.06

References

1. He L, Su Q, Bai L, Li M, Liu J, Liu X, Zhang C, Jiang Z, He J, Shi J, Huang S, Guo L..  (2020)  Recent research progress on natural small molecule bibenzyls and its derivatives in Dendrobium species.,  204  [PMID:32711292] [10.1016/j.ejmech.2020.112530]

Source