The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-(2-(5-(5-(methylsulfonyl)pyridin-2-yl)-4-(o-tolyl)-4H-1,2,4-triazol-3-yl)vinyl)-1,3,4-oxadiazol-2-yl)benzonitrile ID: ALA5276118
Max Phase: Preclinical
Molecular Formula: C26H19N7O3S
Molecular Weight: 509.55
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1-n1c(/C=C/c2nnc(-c3ccc(C#N)cc3)o2)nnc1-c1ccc(S(C)(=O)=O)cn1
Standard InChI: InChI=1S/C26H19N7O3S/c1-17-5-3-4-6-22(17)33-23(29-31-25(33)21-12-11-20(16-28-21)37(2,34)35)13-14-24-30-32-26(36-24)19-9-7-18(15-27)8-10-19/h3-14,16H,1-2H3/b14-13+
Standard InChI Key: XUQMWZKEEWRARY-BUHFOSPRSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-4.1893 -2.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3643 -2.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9579 -1.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3680 -0.6502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1896 -0.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5998 -1.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4215 -1.3591 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.8323 -2.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4215 -0.5359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1326 -0.9475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1362 -1.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7253 -0.6457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9074 -0.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8268 -1.6285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5835 -1.9592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3263 -0.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4673 -0.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0483 0.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8357 0.9126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5447 1.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1659 0.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8647 0.1189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9596 1.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5432 0.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3351 0.6993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5452 1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9641 2.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1725 1.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3389 1.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1326 1.9149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1362 0.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7236 0.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1383 1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9560 1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3669 0.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9580 0.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9019 0.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
6 7 1 0
7 8 1 0
7 9 2 0
7 10 2 0
3 11 1 0
12 11 1 0
12 13 1 0
13 14 2 0
15 14 1 0
11 15 2 0
13 16 1 0
16 17 2 0
17 18 1 0
19 18 2 0
19 20 1 0
20 21 2 0
22 21 1 0
18 22 1 0
23 21 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
29 26 1 0
29 30 3 0
31 12 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 31 2 0
32 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.55Molecular Weight (Monoisotopic): 509.1270AlogP: 4.13#Rotatable Bonds: 6Polar Surface Area: 140.45Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.95CX LogP: 2.98CX LogD: 2.98Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -1.68
References 1. Phull MS, Jadav SS, Gundla R, Mainkar PS.. (2021) A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors., 212 [PMID:33445154 ] [10.1016/j.ejmech.2020.113149 ]