3-((3-(morpholinomethyl)-2H-chromen-8-yloxy)methyl)morpholine

ID: ALA5276321

Max Phase: Preclinical

Molecular Formula: C19H26N2O4

Molecular Weight: 346.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C1=C(CN2CCOCC2)COc2c1cccc2OCC1COCCN1

Standard InChI:  InChI=1S/C19H26N2O4/c1-2-16-10-15(11-21-5-8-22-9-6-21)12-25-19(16)18(3-1)24-14-17-13-23-7-4-20-17/h1-3,10,17,20H,4-9,11-14H2

Standard InChI Key:  BRXSNZMQWIVWOJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    5.6781   -5.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6770   -6.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3897   -6.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3879   -4.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1013   -5.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1001   -6.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8150   -6.4635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5356   -6.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5368   -5.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8173   -4.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3894   -7.2817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6769   -7.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9645   -7.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9664   -6.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2582   -6.0484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5431   -6.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5409   -7.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2537   -7.6957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2503   -4.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9617   -5.2242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9549   -6.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6622   -6.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3781   -6.0572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3821   -5.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6701   -4.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  9 19  1  0
 19 20  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5276321

    ---

Associated Targets(non-human)

Htr1b Serotonin 1b (5-HT1b) receptor (2343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.43Molecular Weight (Monoisotopic): 346.1893AlogP: 1.16#Rotatable Bonds: 5
Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.68CX LogP: 0.95CX LogD: 0.47
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.86Np Likeness Score: -0.22

References

1. Costa M, Dias TA, Brito A, Proença F..  (2016)  Biological importance of structurally diversified chromenes.,  123  [PMID:27494166] [10.1016/j.ejmech.2016.07.057]

Source