Tetraisopropyl 2-(2-tert-butyl-6-tert-pentylpyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5276325

Max Phase: Preclinical

Molecular Formula: C28H53NO6P2

Molecular Weight: 561.68

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(C)(C)c1cc(CC(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(C(C)(C)C)n1

Standard InChI:  InChI=1S/C28H53NO6P2/c1-15-28(13,14)25-17-23(16-24(29-25)27(10,11)12)18-26(36(30,32-19(2)3)33-20(4)5)37(31,34-21(6)7)35-22(8)9/h16-17,19-22,26H,15,18H2,1-14H3

Standard InChI Key:  QQQXEAXOSRMVMF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 37  0  0  0  0  0  0  0  0999 V2000
   -3.2136    0.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4991    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847    0.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847   -0.6639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685   -1.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685   -1.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685   -2.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7830   -2.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3540   -2.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3585   -0.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3585    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3558    0.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702   -0.6602    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.8558   -1.4569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0587   -1.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5245   -1.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1555   -2.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2718   -0.8741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7847   -1.0727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7847   -1.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702   -2.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4992   -2.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7847    0.5772    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.3730    1.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1980    1.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    2.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9605    2.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1980    2.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4992    0.1647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    0.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    1.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9281    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0703    0.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0859    1.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9109    1.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9281    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  6  9  1  0
  5 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 14 19  2  0
 14 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 13 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 24 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 11 34  1  0
 34  3  2  0
  2 35  1  0
  2 36  1  0
  1 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5276325

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 561.68Molecular Weight (Monoisotopic): 561.3348AlogP: 9.02#Rotatable Bonds: 14
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.40CX LogP: 7.95CX LogD: 7.94
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -0.29

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source