Tetraisobutyl 2-(2,6-di-tert-butylpyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5276525

Max Phase: Preclinical

Molecular Formula: C31H59NO6P2

Molecular Weight: 603.76

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)COP(=O)(OCC(C)C)C(Cc1cc(C(C)(C)C)nc(C(C)(C)C)c1)P(=O)(OCC(C)C)OCC(C)C

Standard InChI:  InChI=1S/C31H59NO6P2/c1-22(2)18-35-39(33,36-19-23(3)4)29(40(34,37-20-24(5)6)38-21-25(7)8)17-26-15-27(30(9,10)11)32-28(16-26)31(12,13)14/h15-16,22-25,29H,17-21H2,1-14H3

Standard InChI Key:  ZKOFLWXFYOPZDH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 40  0  0  0  0  0  0  0  0999 V2000
   -3.5709    0.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564    0.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564    1.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5709    0.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420    0.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -0.6713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -1.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -1.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257   -2.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7113   -2.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158   -0.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158    0.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0014    0.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7130    0.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7130   -0.6676    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.4986   -1.4643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0813   -2.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8667   -2.8449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4496   -3.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0700   -3.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0852   -0.8816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275   -1.0802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1419   -0.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564   -1.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5709   -0.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564   -1.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4275    0.5698    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.0158    1.2855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8407    1.2855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    2.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8407    2.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    3.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6658    2.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1419    0.1572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564    0.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564    1.3947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5709    1.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1419    1.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4276    0.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
  5  2  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  7 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 16 22  2  0
 16 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 15 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 28 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 37 39  1  0
 13 40  1  0
 40  5  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5276525

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 603.76Molecular Weight (Monoisotopic): 603.3818AlogP: 9.62#Rotatable Bonds: 16
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.43CX LogP: 9.38CX LogD: 9.38
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -0.14

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source