The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2'-(azanediylbis(ethane-2,1-diyl))bis(5-nitro-1H-benzo[de]isoquinoline-1,3(2H)-dione) ID: ALA5276557
Max Phase: Preclinical
Molecular Formula: C28H19N5O8
Molecular Weight: 553.49
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2cccc3cc([N+](=O)[O-])cc(c23)C(=O)N1CCNCCN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O
Standard InChI: InChI=1S/C28H19N5O8/c34-25-19-5-1-3-15-11-17(32(38)39)13-21(23(15)19)27(36)30(25)9-7-29-8-10-31-26(35)20-6-2-4-16-12-18(33(40)41)14-22(24(16)20)28(31)37/h1-6,11-14,29H,7-10H2
Standard InChI Key: WLQCGLQGPMLKKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
-4.2864 1.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8599 1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8599 0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1507 0.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1489 -0.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8545 -1.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5682 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 1.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4306 1.2372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4306 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7160 -0.0005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0011 1.6494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0011 2.4745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7157 1.2368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7160 1.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0014 1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 1.6497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1424 1.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 1.2372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 1.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2863 1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2863 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9985 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9987 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2886 -1.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5719 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9990 1.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7139 1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7157 0.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1424 -0.0005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2886 -2.0624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5740 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0032 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
5 10 1 0
3 11 1 0
12 11 1 0
13 12 1 0
7 13 1 0
11 14 2 0
13 15 2 0
16 1 1 0
16 17 1 0
16 18 2 0
12 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 2 0
29 28 1 0
24 29 1 0
27 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
26 34 2 0
35 34 1 0
36 35 2 0
30 36 1 0
25 37 2 0
29 38 2 0
39 32 1 0
39 40 1 0
39 41 2 0
M CHG 4 16 1 17 -1 39 1 40 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.49Molecular Weight (Monoisotopic): 553.1234AlogP: 3.29#Rotatable Bonds: 8Polar Surface Area: 173.07Molecular Species: BASEHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.89CX LogP: 3.16CX LogD: 1.66Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.15Np Likeness Score: -0.65
References 1. Chen XM, Zhou JY, Liu SQ, Song LH, Wang HL, Wang Q, Liang SM, Lu L, Wei JH, Huang R, Zhang Y.. (2023) Design, synthesis, and antitumor evaluation of morpholine substituted bisnaphthalimides as DNA targeting agents., 85 [PMID:36894107 ] [10.1016/j.bmcl.2023.129218 ]