Pregnanolone glutamate

ID: ALA5276729

Max Phase: Preclinical

Molecular Formula: C26H41NO5

Molecular Weight: 447.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OC(=O)[C@@H](N)CCC(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C26H41NO5/c1-15(28)19-6-7-20-18-5-4-16-14-17(32-24(31)22(27)8-9-23(29)30)10-12-25(16,2)21(18)11-13-26(19,20)3/h16-22H,4-14,27H2,1-3H3,(H,29,30)/t16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1

Standard InChI Key:  NPNQUIGAVYTZLM-ZLXRDAIVSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.1937    2.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3969    1.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8134    2.4650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1833    1.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3795    0.8345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6651    1.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9508    0.8345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9507    0.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2364   -0.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5221    0.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1921   -0.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1921   -1.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5221   -1.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2364   -1.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9507   -1.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6650   -1.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6650   -0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3795    0.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1620   -0.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6539    0.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4697   -0.8103    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6650    0.4224    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2364   -2.0525    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2364    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9507   -0.8152    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4709    1.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9066   -1.6399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6211   -1.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3356   -1.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6211   -0.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3356   -2.4650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0502   -1.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7647   -1.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4792   -1.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1937   -1.6399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4792   -0.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  4  2  1  1
  5  4  1  0
  5  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 14  9  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17  8  1  0
 16 17  1  0
 18  5  1  0
 17 18  1  0
 18 19  1  0
  4 20  1  0
 19 20  1  0
 18 21  1  6
 17 22  1  1
 14 23  1  1
  9 24  1  1
  8 25  1  6
  5 26  1  1
 12 27  1  6
 27 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  1
 29 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5276729

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate NMDA receptor; GRIN1/GRIN2B (726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.62Molecular Weight (Monoisotopic): 447.2985AlogP: 4.34#Rotatable Bonds: 6
Polar Surface Area: 106.69Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.92CX Basic pKa: 7.41CX LogP: 1.46CX LogD: 1.21
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: 1.84

References

1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG..  (2018)  Breakthroughs in neuroactive steroid drug discovery.,  28  (2): [PMID:29223589] [10.1016/j.bmcl.2017.11.043]

Source