The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pregnanolone glutamate ID: ALA5276729
Max Phase: Preclinical
Molecular Formula: C26H41NO5
Molecular Weight: 447.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OC(=O)[C@@H](N)CCC(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C26H41NO5/c1-15(28)19-6-7-20-18-5-4-16-14-17(32-24(31)22(27)8-9-23(29)30)10-12-25(16,2)21(18)11-13-26(19,20)3/h16-22H,4-14,27H2,1-3H3,(H,29,30)/t16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1
Standard InChI Key: NPNQUIGAVYTZLM-ZLXRDAIVSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
5.1937 2.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3969 1.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8134 2.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1833 1.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3795 0.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6651 1.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9508 0.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9507 0.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2364 -0.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5221 0.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1921 -0.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1921 -1.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5221 -1.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2364 -1.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9507 -1.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6650 -1.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6650 -0.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3795 0.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1620 -0.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6539 0.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4697 -0.8103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6650 0.4224 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.2364 -2.0525 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.2364 0.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9507 -0.8152 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4709 1.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9066 -1.6399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6211 -1.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3356 -1.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6211 -0.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3356 -2.4650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0502 -1.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7647 -1.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4792 -1.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1937 -1.6399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4792 -0.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
4 2 1 1
5 4 1 0
5 6 1 0
6 7 1 0
8 7 1 0
9 8 1 0
9 10 1 0
11 10 1 0
11 12 1 0
12 13 1 0
14 9 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 8 1 0
16 17 1 0
18 5 1 0
17 18 1 0
18 19 1 0
4 20 1 0
19 20 1 0
18 21 1 6
17 22 1 1
14 23 1 1
9 24 1 1
8 25 1 6
5 26 1 1
12 27 1 6
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 1
29 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.62Molecular Weight (Monoisotopic): 447.2985AlogP: 4.34#Rotatable Bonds: 6Polar Surface Area: 106.69Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.92CX Basic pKa: 7.41CX LogP: 1.46CX LogD: 1.21Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: 1.84
References 1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG.. (2018) Breakthroughs in neuroactive steroid drug discovery., 28 (2): [PMID:29223589 ] [10.1016/j.bmcl.2017.11.043 ]