The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,5-dihydroxy-N-((1R,2S)-2-(((2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)carbamoyl)cyclohexyl)benzamide ID: ALA5276974
Max Phase: Preclinical
Molecular Formula: C20H28N2O8
Molecular Weight: 424.45
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1O[C@@H](NC(=O)[C@H]2CCCC[C@H]2NC(=O)c2cc(O)cc(O)c2)[C@@H](O)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C20H28N2O8/c1-9-15(25)16(26)17(27)20(30-9)22-19(29)13-4-2-3-5-14(13)21-18(28)10-6-11(23)8-12(24)7-10/h6-9,13-17,20,23-27H,2-5H2,1H3,(H,21,28)(H,22,29)/t9-,13-,14+,15+,16+,17-,20+/m0/s1
Standard InChI Key: IXPHUTJDXVFANJ-HFEOQFHKSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.5722 -2.6810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8578 -2.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 -2.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 -2.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 -1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 -1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8578 -1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8579 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7146 1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7146 2.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 2.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 2.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1434 1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 1.4435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 -0.2065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 -0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 -1.0316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8579 0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5722 -0.2065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8579 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5722 1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 1.4437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -2.6810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
2 7 2 0
7 6 1 0
6 8 1 0
8 9 2 0
10 8 1 0
11 10 1 1
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
11 16 1 0
16 15 1 0
12 17 1 1
17 18 2 0
19 17 1 0
20 19 1 1
21 20 1 0
21 22 1 1
23 21 1 0
23 24 1 6
25 23 1 0
25 26 1 6
27 25 1 0
27 28 1 6
20 29 1 0
27 29 1 0
4 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.45Molecular Weight (Monoisotopic): 424.1846AlogP: -0.67#Rotatable Bonds: 4Polar Surface Area: 168.58Molecular Species: NEUTRALHBA: 8HBD: 7#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.56CX Basic pKa: ┄CX LogP: -0.33CX LogD: -0.36Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: 0.53
References 1. Cramer J.. (2021) Medicinal chemistry of the myeloid C-type lectin receptors Mincle, Langerin, and DC-SIGN., 12 (12.0): [PMID:35024612 ] [10.1039/D1MD00238D ]