The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dimethylphenyl)-N-methyl-4-oxo-3-(4-phenylpiperazine-1-carbonyl)-1,4-dihydroquinoline-6-sulfonamide ID: ALA5276990
Max Phase: Preclinical
Molecular Formula: C29H30N4O4S
Molecular Weight: 530.65
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(N(C)S(=O)(=O)c2ccc3[nH]cc(C(=O)N4CCN(c5ccccc5)CC4)c(=O)c3c2)cc1C
Standard InChI: InChI=1S/C29H30N4O4S/c1-20-9-10-23(17-21(20)2)31(3)38(36,37)24-11-12-27-25(18-24)28(34)26(19-30-27)29(35)33-15-13-32(14-16-33)22-7-5-4-6-8-22/h4-12,17-19H,13-16H2,1-3H3,(H,30,34)
Standard InChI Key: GUOCLWXSVGOEMV-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
0.3607 0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0753 1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7871 0.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7871 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0771 -0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3607 -0.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3548 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0725 -0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0743 0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3599 1.2416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3548 -1.2403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5018 -0.4115 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2164 0.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0892 -1.1262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7154 -1.2086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2164 0.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 -0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6459 0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3580 -0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3580 -1.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6476 -1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 -1.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6476 -2.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0726 -1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7872 -0.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7872 -1.2388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5018 -0.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2164 -0.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9310 -0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9310 0.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2164 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5018 0.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6457 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3605 0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0726 1.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0726 2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3623 2.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6457 2.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
1 10 1 0
7 11 2 0
4 12 1 0
12 13 1 0
12 14 2 0
12 15 2 0
13 16 1 0
13 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
21 23 1 0
20 24 1 0
8 25 1 0
25 26 2 0
25 27 1 0
28 27 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
27 32 1 0
33 30 1 0
34 33 2 0
35 34 1 0
36 35 2 0
37 36 1 0
33 38 1 0
38 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.65Molecular Weight (Monoisotopic): 530.1988AlogP: 3.93#Rotatable Bonds: 5Polar Surface Area: 93.79Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.46CX Basic pKa: 3.42CX LogP: 4.65CX LogD: 4.65Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.68
References 1. Sethi A, Sanam S, Alvala M.. (2021) Non-carbohydrate strategies to inhibit lectin proteins with special emphasis on galectins., 222 [PMID:34146913 ] [10.1016/j.ejmech.2021.113561 ]