N-(3,4-dimethylphenyl)-N-methyl-4-oxo-3-(4-phenylpiperazine-1-carbonyl)-1,4-dihydroquinoline-6-sulfonamide

ID: ALA5276990

Max Phase: Preclinical

Molecular Formula: C29H30N4O4S

Molecular Weight: 530.65

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(N(C)S(=O)(=O)c2ccc3[nH]cc(C(=O)N4CCN(c5ccccc5)CC4)c(=O)c3c2)cc1C

Standard InChI:  InChI=1S/C29H30N4O4S/c1-20-9-10-23(17-21(20)2)31(3)38(36,37)24-11-12-27-25(18-24)28(34)26(19-30-27)29(35)33-15-13-32(14-16-33)22-7-5-4-6-8-22/h4-12,17-19H,13-16H2,1-3H3,(H,30,34)

Standard InChI Key:  GUOCLWXSVGOEMV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    0.3607    0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0753    1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7871    0.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7871    0.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0771   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3607   -0.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3548   -0.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0725   -0.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0743    0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3599    1.2416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3548   -1.2403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5018   -0.4115    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.2164    0.0010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0892   -1.1262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7154   -1.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2164    0.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9311   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6459    0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3580   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3580   -1.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6476   -1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9311   -1.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6476   -2.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0726   -1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7872   -0.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7872   -1.2388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5018   -0.0010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2164   -0.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9310   -0.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9310    0.8241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2164    1.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5018    0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6457    1.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3605    0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0726    1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0726    2.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3623    2.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6457    2.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  1 10  1  0
  7 11  2  0
  4 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  2  0
 13 16  1  0
 13 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 21 23  1  0
 20 24  1  0
  8 25  1  0
 25 26  2  0
 25 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 27 32  1  0
 33 30  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 37 36  1  0
 33 38  1  0
 38 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5276990

    ---

Associated Targets(Human)

CLEC4M Tbio C-type lectin domain family 4 member M (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 530.65Molecular Weight (Monoisotopic): 530.1988AlogP: 3.93#Rotatable Bonds: 5
Polar Surface Area: 93.79Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.46CX Basic pKa: 3.42CX LogP: 4.65CX LogD: 4.65
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.68

References

1. Sethi A, Sanam S, Alvala M..  (2021)  Non-carbohydrate strategies to inhibit lectin proteins with special emphasis on galectins.,  222  [PMID:34146913] [10.1016/j.ejmech.2021.113561]

Source