The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-((S)-2-((((4-butylcyclohexyl)oxy)carbonyl)amino)-4-methylpentanamido)-1-hydroxy-3-((S)-2-oxopyrrolidin-3-yl)propane-1-sulfonic acid ID: ALA5277063
Max Phase: Preclinical
Molecular Formula: C24H43N3O8S
Molecular Weight: 533.69
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC1CCC(OC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C[C@@H]2CCNC2=O)C(O)S(=O)(=O)O)CC1
Standard InChI: InChI=1S/C24H43N3O8S/c1-4-5-6-16-7-9-18(10-8-16)35-24(31)27-19(13-15(2)3)22(29)26-20(23(30)36(32,33)34)14-17-11-12-25-21(17)28/h15-20,23,30H,4-14H2,1-3H3,(H,25,28)(H,26,29)(H,27,31)(H,32,33,34)/t16?,17-,18?,19-,20-,23?/m0/s1
Standard InChI Key: WKNCKKOHQQLNCY-ULUMWSQISA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
1.7781 -2.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7781 -1.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4896 -1.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0666 -1.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0666 -0.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7781 -0.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7781 0.7397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4895 -0.4924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2013 -0.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2013 0.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9131 1.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6637 0.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2135 1.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8027 2.1393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9990 1.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4178 2.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9131 -0.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9131 -1.3134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6245 -0.0817 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.3359 -0.4924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0360 0.6309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2146 0.6309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3552 -0.0817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3561 -0.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0675 -0.0818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7789 -0.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7789 -1.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4903 -1.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2017 -1.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2017 -0.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4903 -0.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9131 -1.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6245 -1.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6245 -0.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3359 -0.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3561 -1.3139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
5 4 1 6
6 5 1 0
6 7 2 0
8 6 1 0
9 8 1 1
9 10 1 0
11 10 1 1
11 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
15 11 1 0
15 16 2 0
9 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
19 21 2 0
19 22 2 0
5 23 1 0
23 24 1 0
25 24 1 0
25 26 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
31 30 1 0
26 31 1 0
29 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
24 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.69Molecular Weight (Monoisotopic): 533.2771AlogP: 2.09#Rotatable Bonds: 13Polar Surface Area: 171.13Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.05CX Basic pKa: ┄CX LogP: 1.15CX LogD: -0.14Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: 0.51