3-(2,8-dimethyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-N-methyl-N-(7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl)propanamide

ID: ALA5277145

Max Phase: Preclinical

Molecular Formula: C26H28F3N5O

Molecular Weight: 483.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(c1)c1c(n2CCC(=O)N(C)c2c(C(F)(F)F)nc3cc(C)ccn23)CCN(C)C1

Standard InChI:  InChI=1S/C26H28F3N5O/c1-16-5-6-20-18(13-16)19-15-31(3)10-8-21(19)33(20)12-9-23(35)32(4)25-24(26(27,28)29)30-22-14-17(2)7-11-34(22)25/h5-7,11,13-14H,8-10,12,15H2,1-4H3

Standard InChI Key:  GXDYTQBWGHNUMT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    1.0284    1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1685    2.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9480    2.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5793    1.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4341    1.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6577    0.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6850    0.0660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4782   -0.1630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9412    0.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7622    0.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1230   -0.2818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6639   -0.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8404   -0.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1617    3.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9488   -0.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1011   -0.5178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3035   -0.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2802   -0.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0778   -0.6743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0665   -1.6855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6617   -1.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2915    0.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5326   -2.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2680   -2.4479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8515   -1.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4768   -1.1290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6732   -1.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1230   -1.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7519   -0.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9284   -0.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8175   -2.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1024   -2.0733    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8175   -3.3118    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1024   -2.8989    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9488   -1.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
  3 14  1  0
 11 15  1  0
  7 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 19 22  1  0
 23 21  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 21  1  0
 25 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 26 30  1  0
 23 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 28 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277145

    ---

Associated Targets(Human)

GRIN2B Tclin Glutamate [NMDA] receptor subunit epsilon 2 (467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.54Molecular Weight (Monoisotopic): 483.2246AlogP: 4.97#Rotatable Bonds: 4
Polar Surface Area: 45.78Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.13CX LogP: 4.15CX LogD: 3.96
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.37

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source