The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2,8-dimethyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-N-methyl-N-(7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl)propanamide ID: ALA5277145
Max Phase: Preclinical
Molecular Formula: C26H28F3N5O
Molecular Weight: 483.54
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)c1c(n2CCC(=O)N(C)c2c(C(F)(F)F)nc3cc(C)ccn23)CCN(C)C1
Standard InChI: InChI=1S/C26H28F3N5O/c1-16-5-6-20-18(13-16)19-15-31(3)10-8-21(19)33(20)12-9-23(35)32(4)25-24(26(27,28)29)30-22-14-17(2)7-11-34(22)25/h5-7,11,13-14H,8-10,12,15H2,1-4H3
Standard InChI Key: GXDYTQBWGHNUMT-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
1.0284 1.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1685 2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9480 2.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5793 1.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4341 1.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6577 0.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6850 0.0660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4782 -0.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9412 0.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7622 0.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1230 -0.2818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6639 -0.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8404 -0.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1617 3.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9488 -0.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1011 -0.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3035 -0.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2802 -0.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0778 -0.6743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0665 -1.6855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6617 -1.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2915 0.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5326 -2.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2680 -2.4479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8515 -1.8644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4768 -1.1290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6732 -1.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1230 -1.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7519 -0.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9284 -0.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8175 -2.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1024 -2.0733 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8175 -3.3118 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1024 -2.8989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.9488 -1.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
8 7 1 0
9 8 2 0
5 9 1 0
9 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
3 14 1 0
11 15 1 0
7 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
19 22 1 0
23 21 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 21 1 0
25 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
26 30 1 0
23 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
28 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.54Molecular Weight (Monoisotopic): 483.2246AlogP: 4.97#Rotatable Bonds: 4Polar Surface Area: 45.78Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.13CX LogP: 4.15CX LogD: 3.96Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.37