Scutellarin

ID: ALA5277249

Max Phase: Preclinical

Molecular Formula: C21H20O12

Molecular Weight: 464.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CC(c2ccc(O)cc2)Oc2cc(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)c(O)c(O)c21

Standard InChI:  InChI=1S/C21H20O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-4,6,10,16-19,21-22,24-28H,5H2,(H,29,30)/t10?,16-,17-,18+,19-,21+/m0/s1

Standard InChI Key:  DWEKIXALQAUMQL-UHSUVFMESA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -3.5698    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8553    0.6196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8553   -1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5698   -0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4266    0.6193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123   -0.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0037   -1.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7136   -0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0019    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7136    0.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281   -1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    0.6199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425    0.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5741    0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2839    0.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2839    1.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5695    1.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8567    0.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8567    1.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2840    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9982    0.2071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2840   -1.0302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8553   -1.8551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7641   -1.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0037   -1.8538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281   -1.8546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9982    1.8549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2545   -0.8941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2840    1.4441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  3  7  1  1
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12  8  2  0
 13 12  1  0
 13 11  2  0
 11 14  1  0
 15 14  1  0
 13 16  1  0
 17 16  1  0
 17 15  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 18  1  0
 22 17  1  0
 23 22  2  0
 23 21  1  0
  1 24  1  1
 24 25  1  0
  6 26  1  6
  5 27  1  1
  4 28  1  6
 10 29  1  0
 14 30  2  0
 20 31  1  0
  9 32  1  0
 24 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5277249

    ---

Associated Targets(Human)

SLCO2B1 Tchem Solute carrier organic anion transporter family member 2B1 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.38Molecular Weight (Monoisotopic): 464.0955AlogP: -0.22#Rotatable Bonds: 4
Polar Surface Area: 203.44Molecular Species: ACIDHBA: 11HBD: 7
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 2.61CX Basic pKa: CX LogP: 0.58CX LogD: -2.94
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: 2.07

References

1. Peng T, Liu S, Li Y, Zhang H, Hagenbuch B, Gui C..  (2023)  Investigating the interactions of flavonoids with human OATP2B1: inhibition assay, IC50 determination, and structure-activity relationship analysis.,  14  (5): [PMID:37252098] [10.1039/d3md00078h]

Source