The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Scutellarin ID: ALA5277249
Max Phase: Preclinical
Molecular Formula: C21H20O12
Molecular Weight: 464.38
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CC(c2ccc(O)cc2)Oc2cc(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)c(O)c(O)c21
Standard InChI: InChI=1S/C21H20O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-4,6,10,16-19,21-22,24-28H,5H2,(H,29,30)/t10?,16-,17-,18+,19-,21+/m0/s1
Standard InChI Key: DWEKIXALQAUMQL-UHSUVFMESA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.5698 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8553 0.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1408 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1408 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8553 -1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5698 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4266 0.6193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7123 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7123 -0.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0037 -1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7136 -0.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0019 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7136 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 0.6199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5741 0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2839 0.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2839 1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5695 1.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8567 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8567 1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2840 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9982 0.2071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2840 -1.0302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8553 -1.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7641 -1.1860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0037 -1.8538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 -1.8546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9982 1.8549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2545 -0.8941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2840 1.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
3 7 1 1
7 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
12 8 2 0
13 12 1 0
13 11 2 0
11 14 1 0
15 14 1 0
13 16 1 0
17 16 1 0
17 15 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 18 1 0
22 17 1 0
23 22 2 0
23 21 1 0
1 24 1 1
24 25 1 0
6 26 1 6
5 27 1 1
4 28 1 6
10 29 1 0
14 30 2 0
20 31 1 0
9 32 1 0
24 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.38Molecular Weight (Monoisotopic): 464.0955AlogP: -0.22#Rotatable Bonds: 4Polar Surface Area: 203.44Molecular Species: ACIDHBA: 11HBD: 7#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.61CX Basic pKa: ┄CX LogP: 0.58CX LogD: -2.94Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: 2.07
References 1. Peng T, Liu S, Li Y, Zhang H, Hagenbuch B, Gui C.. (2023) Investigating the interactions of flavonoids with human OATP2B1: inhibition assay, IC50 determination, and structure-activity relationship analysis., 14 (5): [PMID:37252098 ] [10.1039/d3md00078h ]