The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
17-bromo-4-hydroper-oxyoscillatoxin B2 ID: ALA5277440
Max Phase: Preclinical
Molecular Formula: C32H45BrO11
Molecular Weight: 685.61
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H](CC[C@H](C)[C@H]1O[C@@]23C[C@H](OC(=O)C[C@H]([C@@H](C)O)OC(=O)/C=C(\O2)[C@@](C)(OO)CC3(C)C)[C@@H]1C)c1cc(O)ccc1Br
Standard InChI: InChI=1S/C32H45BrO11/c1-17(8-11-23(39-7)21-12-20(35)9-10-22(21)33)29-18(2)25-15-32(43-29)30(4,5)16-31(6,44-38)26(42-32)14-28(37)40-24(19(3)34)13-27(36)41-25/h9-10,12,14,17-19,23-25,29,34-35,38H,8,11,13,15-16H2,1-7H3/b26-14-/t17-,18-,19+,23-,24+,25-,29+,31-,32+/m0/s1
Standard InChI Key: IXKNJBBLNNUXPK-KASRWXAJSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
-4.3963 1.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5713 1.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9846 2.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8096 2.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5713 1.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2861 0.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2861 -0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0006 -0.5642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5715 -0.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5715 -1.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3579 -2.1865 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.2859 -1.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2859 -2.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0004 -1.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8567 -1.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -1.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4275 -1.8022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -0.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4273 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4273 -0.9768 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7128 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7128 -1.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0016 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7161 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7161 -1.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4305 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8595 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8595 0.6731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 1.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5740 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5740 -1.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2905 -1.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2905 -2.6259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0006 -1.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0006 -0.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2887 -0.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2887 0.6730 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.3258 0.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 1.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4273 0.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8567 0.6734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 1.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7295 2.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3154 1.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8567 2.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
3 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 1
10 12 1 0
12 13 1 6
12 14 1 0
10 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
19 18 1 0
19 20 1 6
19 21 1 0
21 22 1 1
21 23 1 0
23 24 1 0
24 25 1 6
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 6
29 30 1 0
28 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
33 35 1 0
35 36 2 0
36 37 1 0
37 31 2 0
37 38 1 0
23 39 1 6
40 39 1 0
40 41 1 6
19 41 1 0
42 40 1 0
5 42 1 0
40 43 1 0
43 44 1 0
43 45 1 0
43 46 1 0
2 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 685.61Molecular Weight (Monoisotopic): 684.2145AlogP: 5.57#Rotatable Bonds: 8Polar Surface Area: 150.21Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.92CX Basic pKa: ┄CX LogP: 5.73CX LogD: 5.72Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: 1.88
References 1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L.. (2020) Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species., 201 [PMID:32652435 ] [10.1016/j.ejmech.2020.112473 ]