Tetraisopropyl 2-(2,6-dicyclohexylpyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5277572

Max Phase: Preclinical

Molecular Formula: C31H55NO6P2

Molecular Weight: 599.73

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)OP(=O)(OC(C)C)C(Cc1cc(C2CCCCC2)nc(C2CCCCC2)c1)P(=O)(OC(C)C)OC(C)C

Standard InChI:  InChI=1S/C31H55NO6P2/c1-22(2)35-39(33,36-23(3)4)31(40(34,37-24(5)6)38-25(7)8)21-26-19-29(27-15-11-9-12-16-27)32-30(20-26)28-17-13-10-14-18-28/h19-20,22-25,27-28,31H,9-18,21H2,1-8H3

Standard InChI Key:  LYBAIYWMEMWKNF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   -2.4993    0.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7848    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7848   -0.2514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0686   -0.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0686   -1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3541   -1.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3541   -2.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0686   -3.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7831   -2.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7831   -1.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3585   -0.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3585    0.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3557    0.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702    0.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702   -0.2477    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.8558   -1.0444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0587   -1.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5246   -0.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1557   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2718   -0.4617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7848   -0.6603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7848   -1.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0702   -1.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4992   -1.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7848    0.9896    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.3730    1.7055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1980    1.7055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855    2.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9605    2.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1980    3.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4992    0.5770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    0.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    1.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9282    0.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    0.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2138    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9282    0.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9282    1.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2138    2.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993    1.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  5 10  1  0
  4 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 15 20  2  0
 15 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 14 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 25 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 12 35  1  0
 35  2  2  0
 36  1  1  0
 37 36  1  0
 38 37  1  0
 39 38  1  0
 40 39  1  0
  1 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277572

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 599.73Molecular Weight (Monoisotopic): 599.3505AlogP: 10.13#Rotatable Bonds: 14
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.62CX LogP: 7.93CX LogD: 7.92
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -0.18

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source