4-propylcyclohexyl ((S)-4-methyl-1-oxo-1-(((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)pentan-2-yl)carbamate

ID: ALA5277581

Max Phase: Preclinical

Molecular Formula: C23H39N3O5

Molecular Weight: 437.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC1CCC(OC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)C[C@@H]2CCNC2=O)CC1

Standard InChI:  InChI=1S/C23H39N3O5/c1-4-5-16-6-8-19(9-7-16)31-23(30)26-20(12-15(2)3)22(29)25-18(14-27)13-17-10-11-24-21(17)28/h14-20H,4-13H2,1-3H3,(H,24,28)(H,25,29)(H,26,30)/t16?,17-,18-,19?,20-/m0/s1

Standard InChI Key:  BLRXSZOWSREMKN-DHRHBVOQSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   -5.2970   -1.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5826   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8682   -1.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1538   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1538   -0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4394   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7249   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7249   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4394   -1.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0105   -0.0839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2961   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2961   -1.3213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4183   -0.0839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1327   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1327   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8471   -1.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8471   -2.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5615   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8471   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5615   -0.4963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2764   -0.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9912   -0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9912   -1.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2764    0.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9912    1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0774    1.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4937    2.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8845    2.1465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2970    1.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7449    0.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8471    0.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  4  9  1  0
  9  8  1  0
 10  7  1  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 14 13  1  0
 14 15  1  6
 15 16  1  0
 16 17  1  0
 16 18  1  0
 19 14  1  0
 20 19  1  0
 21 20  1  1
 21 22  1  0
 22 23  2  0
 21 24  1  0
 25 24  1  1
 26 25  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 25 30  1  0
 19 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5277581

    ---

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L929 (3802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.58Molecular Weight (Monoisotopic): 437.2890AlogP: 2.70#Rotatable Bonds: 11
Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.74CX Basic pKa: CX LogP: 2.53CX LogD: 2.53
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: 0.63

References

1. Gao K, Wang R, Chen J, Tepe JJ, Huang F, Wei GW..  (2021)  Perspectives on SARS-CoV-2 Main Protease Inhibitors.,  64  (23.0): [PMID:34798775] [10.1021/acs.jmedchem.1c00409]

Source