The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-1-((S)-2-(1-cyanocyclopropanecarboxamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-((S)-3-(methylamino)-1-(4-(4-methylthiazol-5-yl)phenyl)-3-oxopropyl)pyrrolidine-2-carboxamide ID: ALA5277721
Max Phase: Preclinical
Molecular Formula: C30H38N6O5S
Molecular Weight: 594.74
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)C[C@H](NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](NC(=O)C1(C#N)CC1)C(C)(C)C)c1ccc(-c2scnc2C)cc1
Standard InChI: InChI=1S/C30H38N6O5S/c1-17-24(42-16-33-17)19-8-6-18(7-9-19)21(13-23(38)32-5)34-26(39)22-12-20(37)14-36(22)27(40)25(29(2,3)4)35-28(41)30(15-31)10-11-30/h6-9,16,20-22,25,37H,10-14H2,1-5H3,(H,32,38)(H,34,39)(H,35,41)/t20-,21+,22+,25-/m1/s1
Standard InChI Key: TXOUIGUFBKWBLO-HXKBJWFLSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
32.8746 -6.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0788 -6.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6643 -7.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3775 -5.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3763 -6.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0911 -6.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8075 -6.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8047 -5.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0893 -4.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0868 -4.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8000 -3.7350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5157 -4.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2289 -3.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5182 -4.9704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9842 -4.0623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5344 -3.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1197 -2.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3133 -2.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4530 -1.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1590 -4.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5481 -5.4231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9446 -5.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1194 -5.9266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5554 -4.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3411 -4.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3807 -3.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0960 -7.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4284 -7.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6832 -8.7221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5082 -8.7223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7632 -7.9376 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.6438 -7.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3711 -3.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3687 -2.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6529 -2.5040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0819 -2.4996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6505 -1.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1371 -3.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9051 -6.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5159 -5.6238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4691 -7.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8628 -8.0943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 12 1 6
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 13 1 0
17 19 1 1
15 20 1 0
20 21 2 0
20 22 1 0
22 23 1 6
22 24 1 0
24 25 1 0
24 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
6 27 1 0
28 32 1 0
10 33 1 6
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
24 38 1 0
23 39 1 0
39 2 1 0
39 40 2 0
2 41 1 0
41 42 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.74Molecular Weight (Monoisotopic): 594.2624AlogP: 2.21#Rotatable Bonds: 9Polar Surface Area: 164.52Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.43CX Basic pKa: 2.65CX LogP: 0.45CX LogD: 0.45Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.35Np Likeness Score: -0.54
References 1. Han X, Wang C, Qin C, Xiang W, Fernandez-Salas E, Yang CY, Wang M, Zhao L, Xu T, Chinnaswamy K, Delproposto J, Stuckey J, Wang S.. (2019) Discovery of ARD-69 as a Highly Potent Proteolysis Targeting Chimera (PROTAC) Degrader of Androgen Receptor (AR) for the Treatment of Prostate Cancer., 62 (2): [PMID:30629437 ] [10.1021/acs.jmedchem.8b01631 ]