(4-(((3-fluoro-N-(4-(thiophen-2-yl)thiazol-2-yl)phenyl)sulfonamido)methyl)phenyl)sulfamic acid

ID: ALA5277754

Max Phase: Preclinical

Molecular Formula: C20H16FN3O5S4

Molecular Weight: 525.63

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(O)Nc1ccc(CN(c2nc(-c3cccs3)cs2)S(=O)(=O)c2cccc(F)c2)cc1

Standard InChI:  InChI=1S/C20H16FN3O5S4/c21-15-3-1-4-17(11-15)32(25,26)24(20-22-18(13-31-20)19-5-2-10-30-19)12-14-6-8-16(9-7-14)23-33(27,28)29/h1-11,13,23H,12H2,(H,27,28,29)

Standard InChI Key:  ONPQLLZMXWDYLA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.4905    1.9385    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7724    1.5325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0616    1.9513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6564    1.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6638    0.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3820    0.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0927    0.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8109    0.3269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5217    0.7457    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5143    1.5708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0854    1.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3672    1.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7650    0.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3470    0.7457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7353   -0.0513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2053    1.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4760    0.2885    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2832   -0.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4810   -0.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1556    0.1577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0683   -1.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9201    1.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6324    1.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6324    0.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9220    0.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2053    0.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4810   -2.0344    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0903   -2.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8250   -2.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7326   -1.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0779    2.6533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9032    2.6533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3470    1.9390    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  9 14  2  0
  9 15  2  0
  1 16  1  0
 17 13  1  0
 17 18  1  0
 18 19  2  0
 20 19  1  0
 13 20  2  0
 19 21  1  0
 22 16  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 16 26  1  0
 27 21  1  0
 27 28  1  0
 28 29  2  0
 30 29  1  0
 21 30  2  0
  1 31  2  0
  1 32  2  0
 23 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277754

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.63Molecular Weight (Monoisotopic): 524.9957AlogP: 4.62#Rotatable Bonds: 8
Polar Surface Area: 116.67Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: -1.84CX Basic pKa: CX LogP: 2.46CX LogD: 1.82
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -2.15

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source