N-(1-(3-(2-methoxyphenoxy)benzyl)piperidin-4-yl)-2-phenyl-4-(pyrrolidin-1-yl)butanamide

ID: ALA5277802

Max Phase: Preclinical

Molecular Formula: C33H41N3O3

Molecular Weight: 527.71

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1Oc1cccc(CN2CCC(NC(=O)C(CCN3CCCC3)c3ccccc3)CC2)c1

Standard InChI:  InChI=1S/C33H41N3O3/c1-38-31-14-5-6-15-32(31)39-29-13-9-10-26(24-29)25-36-21-16-28(17-22-36)34-33(37)30(27-11-3-2-4-12-27)18-23-35-19-7-8-20-35/h2-6,9-15,24,28,30H,7-8,16-23,25H2,1H3,(H,34,37)

Standard InChI Key:  KCCCUDLTAIFJLP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -5.8307    0.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0710    0.8899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3643    0.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6424    0.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9357    0.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9509   -0.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2137    0.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5070    0.4116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7850    0.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0783    0.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6436    0.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6588    1.6093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0478    2.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7698    1.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1985    1.6620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1421    1.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9458    1.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3714    1.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2440   -0.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2600   -1.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9824   -2.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6866   -1.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6762   -0.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3734    2.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0881    1.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8029    2.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5151    1.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5151    0.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8048    0.3722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0881    0.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2297    2.0223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9444    1.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6593    2.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3714    1.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3714    0.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6611    0.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9444    0.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2297    0.3683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2297   -0.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  9  1  0
  7 15  2  0
 16  2  1  0
 17 16  1  0
  1 18  1  0
 18 17  1  0
 19  6  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
  6 23  1  0
 12 24  1  0
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 27 31  1  0
 31 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277802

    ---

Associated Targets(Human)

CCR8 Tchem C-C chemokine receptor type 8 (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

COS-7 (515 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.71Molecular Weight (Monoisotopic): 527.3148AlogP: 5.84#Rotatable Bonds: 11
Polar Surface Area: 54.04Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.53CX LogP: 4.79CX LogD: 2.00
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: -1.03

References

1. Arimont M, Sun SL, Leurs R, Smit M, de Esch IJP, de Graaf C..  (2017)  Structural Analysis of Chemokine Receptor-Ligand Interactions.,  60  (12): [PMID:28165741] [10.1021/acs.jmedchem.6b01309]

Source