The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-chloro-2-methylphenyl)-2-(2-chlorophenyl)-4-(trifluoromethyl)thiazole-5-carboxamide ID: ALA5277872
Max Phase: Preclinical
Molecular Formula: C18H11Cl2F3N2OS
Molecular Weight: 431.27
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Cl)ccc1NC(=O)c1sc(-c2ccccc2Cl)nc1C(F)(F)F
Standard InChI: InChI=1S/C18H11Cl2F3N2OS/c1-9-8-10(19)6-7-13(9)24-16(26)14-15(18(21,22)23)25-17(27-14)11-4-2-3-5-12(11)20/h2-8H,1H3,(H,24,26)
Standard InChI Key: XPDAMVRWGHRCCC-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-3.9594 -0.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9594 -1.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2460 -2.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5389 -1.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5389 -0.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2477 -0.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8273 -0.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8273 0.3142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0265 0.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5577 -0.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0477 -0.7522 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.2639 -0.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6747 0.6241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4964 0.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9075 1.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7267 1.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1377 0.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7303 -0.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9090 -0.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9594 0.6230 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.4967 2.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6747 -0.7991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8138 1.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3949 1.9381 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0202 1.5697 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.6012 2.1507 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.8273 -2.1507 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
8 7 2 0
8 9 1 0
9 10 2 0
11 10 1 0
7 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
17 20 1 0
15 21 1 0
12 22 2 0
9 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
4 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.27Molecular Weight (Monoisotopic): 429.9921AlogP: 6.70#Rotatable Bonds: 3Polar Surface Area: 41.99Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.93CX Basic pKa: ┄CX LogP: 6.87CX LogD: 6.87Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.50Np Likeness Score: -2.08
References 1. Sharma PC, Bansal KK, Sharma A, Sharma D, Deep A.. (2020) Thiazole-containing compounds as therapeutic targets for cancer therapy., 188 [PMID:31926469 ] [10.1016/j.ejmech.2019.112016 ]