[4-[[3-[(1R)-1-(2,6-dichloro-3-fluoro-phenyl)ethoxy]-5-[1-(4-piperidyl)pyrazol-4-yl]-2-pyridyl]carbamoyloxymethyl]phenyl]boronic acid

ID: ALA5277922

Max Phase: Preclinical

Molecular Formula: C29H29BCl2FN5O5

Molecular Weight: 628.30

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](Oc1cc(-c2cnn(C3CCNCC3)c2)cnc1NC(=O)OCc1ccc(B(O)O)cc1)c1c(Cl)ccc(F)c1Cl

Standard InChI:  InChI=1S/C29H29BCl2FN5O5/c1-17(26-23(31)6-7-24(33)27(26)32)43-25-12-19(20-14-36-38(15-20)22-8-10-34-11-9-22)13-35-28(25)37-29(39)42-16-18-2-4-21(5-3-18)30(40)41/h2-7,12-15,17,22,34,40-41H,8-11,16H2,1H3,(H,35,37,39)/t17-/m1/s1

Standard InChI Key:  XIDQHQDOVAVPEC-QGZVFWFLSA-N

Molfile:  

 
     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
   -5.8261    0.4854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1116    0.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3971    0.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3971   -0.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1116   -0.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8261   -0.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6829   -0.7519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9687   -0.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3503   -0.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6807   -1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5045   -1.5524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5536   -0.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3398    0.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5454    0.3115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0378   -0.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1730   -1.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9679   -1.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8345   -0.0583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4101   -1.6481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2068   -1.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7900   -2.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4202   -0.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -1.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1677   -2.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9541   -3.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1618   -3.3973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5756   -2.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8002   -1.0079    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9643   -2.1731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7789   -3.0313    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.0479    0.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8446    0.9517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0581    1.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8547    1.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4647    1.3214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0684    2.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8629    2.9706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4462    2.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2353    1.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4404    1.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2429    2.6006    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    5.4564    3.3973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8261    2.0174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  4  7  1  0
  8  7  1  0
  8  9  2  0
  9 10  1  0
 11 10  2  0
  7 11  1  0
  9 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 15 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  6
 23 21  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 21 27  1  0
 23 28  1  0
 24 29  1  0
 27 30  1  0
 18 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 31 35  2  0
 36 34  2  0
 37 36  1  0
 38 37  2  0
 39 38  1  0
 40 39  2  0
 34 40  1  0
 38 41  1  0
 41 42  1  0
 41 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277922

    ---

Associated Targets(Human)

NCI-H1993 (343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 628.30Molecular Weight (Monoisotopic): 627.1623AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Maslah H, Skarbek C, Pethe S, Labruère R..  (2020)  Anticancer boron-containing prodrugs responsive to oxidative stress from the tumor microenvironment.,  207  [PMID:32858470] [10.1016/j.ejmech.2020.112670]

Source