The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2,6-dichlorophenyl)-6-(3-(4-hydroxy-3-methoxyphenyl)acryloyl)-7-(4-hydroxy-3-methoxystyryl)-1H-pyrano[2,3-d]pyrimidine-2,4(3H,5H)-dione ID: ALA5277933
Max Phase: Preclinical
Molecular Formula: C32H24Cl2N2O8
Molecular Weight: 635.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)C2=C(/C=C/c3ccc(O)c(OC)c3)Oc3[nH]c(=O)[nH]c(=O)c3C2c2c(Cl)cccc2Cl)ccc1O
Standard InChI: InChI=1S/C32H24Cl2N2O8/c1-42-24-14-16(6-10-20(24)37)8-12-22(39)27-23(13-9-17-7-11-21(38)25(15-17)43-2)44-31-29(30(40)35-32(41)36-31)28(27)26-18(33)4-3-5-19(26)34/h3-15,28,37-38H,1-2H3,(H2,35,36,40,41)/b12-8+,13-9+
Standard InChI Key: INAKRSJFESUJLG-QHKWOANTSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
0.3578 2.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3578 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3567 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7856 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5032 1.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9294 1.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6439 1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 0.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9278 -0.2041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4986 -0.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7856 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0723 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0723 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3578 -0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3578 -1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3567 -1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 -1.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 -1.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 -2.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4988 -2.6790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0696 -2.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0696 -3.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3551 -3.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3567 -2.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7865 -0.2057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5008 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 -0.2057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9294 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6439 -0.2059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9294 1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 2.2687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5008 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7865 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7865 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5041 2.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5041 3.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7876 3.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0721 3.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0721 2.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2471 2.6815 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.7176 1.8861 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
7 10 1 0
10 11 1 0
10 12 2 0
12 13 1 0
13 5 2 0
14 2 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
21 23 2 0
23 24 1 0
24 25 1 0
23 26 1 0
26 18 2 0
15 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 2 0
35 33 1 0
28 35 2 0
35 36 1 0
14 36 1 0
37 36 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 37 2 0
42 43 1 0
38 44 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.46Molecular Weight (Monoisotopic): 634.0910AlogP: 5.57#Rotatable Bonds: 8Polar Surface Area: 150.94Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.48CX Basic pKa: ┄CX LogP: 5.65CX LogD: 5.62Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: 0.03
References 1. Elattar KM, El-Khateeb AY, Hamed SE.. (2022) Insights into the recent progress in the medicinal chemistry of pyranopyrimidine analogs., 13 (5.0): [PMID:35694689 ] [10.1039/d2md00076h ]