3-acetyl-4,7-dimethyl-6-phenylpyrrolo[2,1-c][1,2,4]triazine-8-carbonitrile

ID: ALA5277935

Max Phase: Preclinical

Molecular Formula: C17H14N4O

Molecular Weight: 290.33

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1nnc2c(C#N)c(C)c(-c3ccccc3)n2c1C

Standard InChI:  InChI=1S/C17H14N4O/c1-10-14(9-18)17-20-19-15(12(3)22)11(2)21(17)16(10)13-7-5-4-6-8-13/h4-8H,1-3H3

Standard InChI Key:  QGXQKQVLNNICNO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -0.3789    0.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3356    1.2254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0474    0.8134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0474   -0.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3374   -0.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3789   -0.0154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1668    1.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1669   -0.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6537    0.3989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3811    1.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5955    2.6691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4820    0.3989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3812   -1.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7956   -1.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0101   -2.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8104   -2.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3943   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1846   -1.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7647   -0.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4820   -0.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7647   -1.2541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3374   -1.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  1  7  2  0
  6  8  1  0
  8  9  2  0
  9  7  1  0
  7 10  1  0
 10 11  3  0
  9 12  1  0
 13  8  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 13 18  1  0
 18 17  2  0
  4 19  1  0
 19 20  1  0
 19 21  2  0
  5 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277935

    ---

Associated Targets(Human)

OVCAR-4 (44535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.33Molecular Weight (Monoisotopic): 290.1168AlogP: 3.09#Rotatable Bonds: 2
Polar Surface Area: 71.05Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.86CX LogD: 1.86
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.68Np Likeness Score: -1.11

References

1. Cascioferro S, Parrino B, Spanò V, Carbone A, Montalbano A, Barraja P, Diana P, Cirrincione G..  (2017)  An overview on the recent developments of 1,2,4-triazine derivatives as anticancer compounds.,  142  [PMID:28851503] [10.1016/j.ejmech.2017.08.009]

Source