N-(2-(decylamino)-2-oxoethyl)-N,N-dimethyl-3-(4-methylbenzamido)propan-1-aminium

ID: ALA5277938

Max Phase: Preclinical

Molecular Formula: C25H44N3O2+

Molecular Weight: 418.65

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCNC(=O)C[N+](C)(C)CCCNC(=O)c1ccc(C)cc1

Standard InChI:  InChI=1S/C25H43N3O2/c1-5-6-7-8-9-10-11-12-18-26-24(29)21-28(3,4)20-13-19-27-25(30)23-16-14-22(2)15-17-23/h14-17H,5-13,18-21H2,1-4H3,(H-,26,27,29,30)/p+1

Standard InChI Key:  FJUALOARVLDAIR-UHFFFAOYSA-O

Molfile:  

 
     RDKit          2D

 30 30  0  0  0  0  0  0  0  0999 V2000
    7.8630   -1.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1521   -0.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4304   -1.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7233   -0.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7302    0.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4454    0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1612   -0.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0187    0.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3001    0.0274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5886    0.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8661    0.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1586    0.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4362    0.0659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7228    0.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0040    0.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7074    0.5117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4297    0.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1375    0.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8553    0.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5687    0.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2875    0.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9990    0.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7251    0.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4273    0.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1533    0.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8630    0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0084   -0.7404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0114   -0.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8379   -0.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0332    1.2554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 15 27  2  0
 13 28  1  0
 13 29  1  0
  8 30  2  0
M  CHG  1  13   1
M  END

Alternative Forms

  1. Parent:

    ALA5277938

    ---

Associated Targets(non-human)

Enterococcus (1748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.65Molecular Weight (Monoisotopic): 418.3428AlogP: 4.45#Rotatable Bonds: 16
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.36CX LogD: 0.36
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.44

References

1. Sarkar P, Basak D, Mukherjee R, Bandow JE, Haldar J..  (2021)  Alkyl-Aryl-Vancomycins: Multimodal Glycopeptides with Weak Dependence on the Bacterial Metabolic State.,  64  (14.0): [PMID:34233118] [10.1021/acs.jmedchem.1c00449]

Source