Tetraisopropyl 2-(2-tert-butyl-6-(pentan-3-yl)pyridin-4-yl)ethan-1,1-bisphosphonate

ID: ALA5277972

Max Phase: Preclinical

Molecular Formula: C28H53NO6P2

Molecular Weight: 561.68

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(CC)c1cc(CC(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(C(C)(C)C)n1

Standard InChI:  InChI=1S/C28H53NO6P2/c1-14-24(15-2)25-16-23(17-26(29-25)28(11,12)13)18-27(36(30,32-19(3)4)33-20(5)6)37(31,34-21(7)8)35-22(9)10/h16-17,19-22,24,27H,14-15,18H2,1-13H3

Standard InChI Key:  SUJRRHGSAKZTAN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 37  0  0  0  0  0  0  0  0999 V2000
   -3.5711    0.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8567    0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1421    0.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1421   -0.6640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4258   -1.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4258   -1.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4258   -2.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1404   -2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7113   -2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158   -0.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0014    0.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -0.6603    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.4986   -1.4569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2985   -1.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8818   -1.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5129   -2.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0853   -0.8742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276   -1.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276   -1.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -2.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1421   -2.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4276    0.5772    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.0159    1.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8409    1.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4283    2.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6032    2.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8409    2.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1421    0.1647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    0.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    1.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5711    0.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4277    0.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8567    1.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    1.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711   -0.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  6  9  1  0
  5 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 14 19  2  0
 14 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 13 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 24 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 11 34  1  0
 34  3  2  0
  2 35  1  0
 35 36  1  0
  1 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5277972

    ---

Associated Targets(Human)

HMGCR Tclin HMG-CoA reductase (2475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 561.68Molecular Weight (Monoisotopic): 561.3348AlogP: 9.24#Rotatable Bonds: 15
Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.53CX LogP: 7.78CX LogD: 7.77
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -0.20

References

1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K..  (2023)  Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase.,  78  [PMID:36580745] [10.1016/j.bmc.2022.117145]

Source