The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tetraisopropyl 2-(2-tert-butyl-6-(pentan-3-yl)pyridin-4-yl)ethan-1,1-bisphosphonate ID: ALA5277972
Max Phase: Preclinical
Molecular Formula: C28H53NO6P2
Molecular Weight: 561.68
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)c1cc(CC(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(C(C)(C)C)n1
Standard InChI: InChI=1S/C28H53NO6P2/c1-14-24(15-2)25-16-23(17-26(29-25)28(11,12)13)18-27(36(30,32-19(3)4)33-20(5)6)37(31,34-21(7)8)35-22(9)10/h16-17,19-22,24,27H,14-15,18H2,1-13H3
Standard InChI Key: SUJRRHGSAKZTAN-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
-3.5711 0.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8567 0.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1421 0.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1421 -0.6640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4258 -1.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4258 -1.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4258 -2.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1404 -2.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7113 -2.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7158 -0.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7158 0.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0014 0.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 0.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -0.6603 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
0.4986 -1.4569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2985 -1.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8818 -1.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5129 -2.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0853 -0.8742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -1.0728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -1.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -2.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 -2.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 0.5772 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.0159 1.2931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8409 1.2931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4283 2.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6032 2.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8409 2.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 0.1647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 0.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 1.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5711 0.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4277 0.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8567 1.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5711 1.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5711 -0.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
6 8 1 0
6 9 1 0
5 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
14 19 2 0
14 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
13 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
24 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
11 34 1 0
34 3 2 0
2 35 1 0
35 36 1 0
1 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.68Molecular Weight (Monoisotopic): 561.3348AlogP: 9.24#Rotatable Bonds: 15Polar Surface Area: 83.95Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.53CX LogP: 7.78CX LogD: 7.77Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -0.20
References 1. Kawamura K, Yoshioka H, Sato C, Yajima T, Furuyama Y, Kuramochi K, Ohgane K.. (2023) Fine-tuning of nitrogen-containing bisphosphonate esters that potently induce degradation of HMG-CoA reductase., 78 [PMID:36580745 ] [10.1016/j.bmc.2022.117145 ]