The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((2-(3-fluorophenyl)-N-(4-phenylthiazol-2-yl)acetamido)methyl)phenyl)sulfamic acid ID: ALA5277981
Max Phase: Preclinical
Molecular Formula: C24H20FN3O4S2
Molecular Weight: 497.57
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1cccc(F)c1)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccccc2)cs1
Standard InChI: InChI=1S/C24H20FN3O4S2/c25-20-8-4-5-18(13-20)14-23(29)28(15-17-9-11-21(12-10-17)27-34(30,31)32)24-26-22(16-33-24)19-6-2-1-3-7-19/h1-13,16,27H,14-15H2,(H,30,31,32)
Standard InChI Key: SSRKIYQNFCWELW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
1.1319 1.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4137 1.3186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2970 1.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0152 1.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0225 0.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7407 0.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4515 0.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1696 0.1130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8804 0.5318 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8730 1.3569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4441 1.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7259 1.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4063 0.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1392 2.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7057 0.5318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0940 -0.2652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8466 1.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1173 0.0746 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9246 -0.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1223 -0.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2030 -0.0560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2902 -1.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1221 -2.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2899 -2.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1154 -2.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5273 -2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1191 -1.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5613 1.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5615 2.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2745 2.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9893 2.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9909 1.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2791 1.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7057 1.3141 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
1 14 2 0
9 15 2 0
9 16 2 0
1 17 1 0
18 13 1 0
18 19 1 0
19 20 2 0
21 20 1 0
13 21 2 0
20 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
28 17 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.57Molecular Weight (Monoisotopic): 497.0879AlogP: 4.94#Rotatable Bonds: 8Polar Surface Area: 99.60Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.72CX Basic pKa: ┄CX LogP: 3.13CX LogD: 2.27Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.85
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]