The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((3-(4-hydroxy-3-methoxyphenyl)acryloyl)-7-((4-hydroxy-3-methoxystyryl)-5-(4-nitrophenyl)-1H-pyrano[2,3-d]pyrimidine-2,4(3H,5H)-dione ID: ALA5278001
Max Phase: Preclinical
Molecular Formula: C32H25N3O10
Molecular Weight: 611.56
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)C2=C(/C=C/c3ccc(O)c(OC)c3)Oc3[nH]c(=O)[nH]c(=O)c3C2c2ccc([N+](=O)[O-])cc2)ccc1O
Standard InChI: InChI=1S/C32H25N3O10/c1-43-25-15-17(3-11-21(25)36)5-13-23(38)28-24(14-6-18-4-12-22(37)26(16-18)44-2)45-31-29(30(39)33-32(40)34-31)27(28)19-7-9-20(10-8-19)35(41)42/h3-16,27,36-37H,1-2H3,(H2,33,34,39,40)/b13-5+,14-6+
Standard InChI Key: XHSJHCJBIXVECB-ACFHMISVSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
2.5056 2.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5056 2.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7886 3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0735 2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0735 2.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7876 1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7876 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5023 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2170 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2170 1.6509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9317 0.4128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9317 -0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6467 -0.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2170 -0.8251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5023 -0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7876 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0729 -0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 -1.6507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3569 -2.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0748 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7854 -2.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7854 -2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5003 -3.2997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0702 -3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0702 -4.1254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 -4.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3569 -2.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0729 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 1.6511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3569 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7867 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5047 0.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2168 0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9317 0.8234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6467 0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2168 -0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9301 -0.8234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5001 -0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7867 -0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7886 4.1254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0738 4.5382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5035 4.5382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 7 1 0
8 9 1 0
9 10 2 0
11 9 1 0
12 11 1 0
12 13 2 0
14 12 1 0
15 14 1 0
15 8 2 0
16 15 1 0
17 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
23 25 2 0
25 26 1 0
26 27 1 0
25 28 1 0
28 20 2 0
29 17 2 0
29 7 1 0
29 30 1 0
30 31 2 0
30 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 1 0
36 39 1 0
39 40 1 0
39 41 2 0
41 42 1 0
42 34 2 0
43 3 1 0
43 44 2 0
43 45 1 0
M CHG 2 43 1 45 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 611.56Molecular Weight (Monoisotopic): 611.1540AlogP: 4.17#Rotatable Bonds: 9Polar Surface Area: 194.08Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.37CX Basic pKa: ┄CX LogP: 4.38CX LogD: 4.34Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.12Np Likeness Score: -0.08
References 1. Elattar KM, El-Khateeb AY, Hamed SE.. (2022) Insights into the recent progress in the medicinal chemistry of pyranopyrimidine analogs., 13 (5.0): [PMID:35694689 ] [10.1039/d2md00076h ]