Neomarchantin B

ID: ALA5278061

Max Phase: Preclinical

Molecular Formula: C28H24O5

Molecular Weight: 440.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1ccc2cc1Oc1ccc(cc1)CCc1ccc(c(O)c1O)Oc1cccc(c1)CC2

Standard InChI:  InChI=1S/C28H24O5/c29-24-14-9-20-5-4-19-2-1-3-23(16-19)33-25-15-11-21(27(30)28(25)31)10-6-18-7-12-22(13-8-18)32-26(24)17-20/h1-3,7-9,11-17,29-31H,4-6,10H2

Standard InChI Key:  IPOMWFZPWNPRIE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -2.8574   -3.0938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4266   -3.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0021   -3.0893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123   -2.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123   -1.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4253   -1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4253   -0.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1398   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1398    0.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8574    1.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8574    1.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1408    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1408    3.0938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4261    1.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7116    2.2699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128    2.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4276    1.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4276    1.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139    0.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139   -0.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4284   -0.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4284   -1.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7166   -1.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7166   -2.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429   -1.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8574   -1.4404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0011    1.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0011    1.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4261    1.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1416   -1.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1416   -2.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4299   -3.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  3  4  1  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 15 16  1  0
 17 16  1  0
 18 17  2  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 23 24  1  0
 24 25  2  0
 25  3  1  0
 23 26  2  0
 26  2  1  0
 26 27  1  0
 20 28  1  0
 29 28  2  0
 17 29  1  0
 15 30  1  0
 30 10  2  0
  7 31  2  0
 31 32  1  0
 32 33  2  0
  5 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278061

    ---

Associated Targets(non-human)

Trichophyton mentagrophytes (4846 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.50Molecular Weight (Monoisotopic): 440.1624AlogP: 6.27#Rotatable Bonds:
Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.45CX Basic pKa: CX LogP: 7.16CX LogD: 7.12
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: 1.91

References

1. Asakawa Y, Ludwiczuk A..  (2018)  Chemical Constituents of Bryophytes: Structures and Biological Activity.,  81  (3): [PMID:29019405] [10.1021/acs.jnatprod.6b01046]

Source