The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5278089
Max Phase: Preclinical
Molecular Formula: C21H18N2O4S
Molecular Weight: 394.45
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2CS
Standard InChI: InChI=1S/C21H18N2O4S/c1-2-21(26)15-7-17-18-12(8-23(17)19(24)13(15)9-27-20(21)25)14(10-28)11-5-3-4-6-16(11)22-18/h3-7,26,28H,2,8-10H2,1H3/t21-/m0/s1
Standard InChI Key: UBRXAFRHRLKFID-NRFANRHFSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
-3.2219 1.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2202 0.2974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5048 -0.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7913 0.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0758 -0.1102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3623 0.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4228 0.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7600 -0.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5807 -0.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9179 -1.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1177 -1.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7386 -1.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0758 -2.3769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 -0.9555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8847 -0.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0641 -0.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7269 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2104 1.3031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9062 0.7190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4198 1.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3641 1.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0794 1.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7931 1.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5085 1.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9179 -2.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6326 -2.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0794 2.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3648 2.7775 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 1
10 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
9 16 2 0
16 17 1 0
17 18 2 0
17 19 1 0
7 19 1 0
19 20 1 0
20 21 1 0
6 21 1 0
21 22 2 0
22 23 1 0
4 23 2 0
23 24 1 0
24 1 2 0
10 25 1 0
25 26 1 0
22 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.45Molecular Weight (Monoisotopic): 394.0987AlogP: 2.51#Rotatable Bonds: 2Polar Surface Area: 81.42Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.91CX Basic pKa: 3.00CX LogP: 1.70CX LogD: 1.70Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.40Np Likeness Score: 0.93
References 1. Khaiwa N, Maarouf NR, Darwish MH, Alhamad DWM, Sebastian A, Hamad M, Omar HA, Orive G, Al-Tel TH.. (2021) Camptothecin's journey from discovery to WHO Essential Medicine: Fifty years of promise., 223 [PMID:34175539 ] [10.1016/j.ejmech.2021.113639 ]