4-[3-(4-hydroxyphenyl)-5-(4-methylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]benzene-1-sulfonamide

ID: ALA5278162

Max Phase: Preclinical

Molecular Formula: C22H21N3O3S

Molecular Weight: 407.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C2CC(c3ccc(O)cc3)=NN2c2ccc(S(N)(=O)=O)cc2)cc1

Standard InChI:  InChI=1S/C22H21N3O3S/c1-15-2-4-17(5-3-15)22-14-21(16-6-10-19(26)11-7-16)24-25(22)18-8-12-20(13-9-18)29(23,27)28/h2-13,22,26H,14H2,1H3,(H2,23,27,28)

Standard InChI Key:  JFKHNQGQBSBMGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -0.7718   -0.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0531   -0.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3033   -1.0055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3502   -1.4762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0177   -0.9843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8145   -1.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0282   -1.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8228   -2.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4064   -1.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1954   -0.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4002   -0.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1001   -1.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3139   -2.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1084   -2.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6919   -1.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4810   -0.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6860   -0.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4887   -1.8579    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7022   -2.6547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4887   -1.0330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2032   -1.4454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4656    0.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2905    0.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7011    1.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2885    1.9403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4677    1.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0514    1.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2032   -1.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7010    2.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  1  0
  5  4  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  3 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  2  0
 18 21  2  0
 22  2  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 22 27  1  0
 27 26  2  0
  9 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278162

    ---

Associated Targets(Human)

Ca9-22 (362 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HSC-2 (771 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HSC-3 (372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.50Molecular Weight (Monoisotopic): 407.1304AlogP: 3.70#Rotatable Bonds: 4
Polar Surface Area: 95.99Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.06CX Basic pKa: 4.14CX LogP: 4.23CX LogD: 4.22
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.25

References

1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V..  (2020)  Recent advancements in the development of bioactive pyrazoline derivatives.,  205  [PMID:32795767] [10.1016/j.ejmech.2020.112666]

Source